About carbanide;4-[3-(2,3-dihydroxypropoxy)propyl]benzaldehyde;yttrium
carbanide;4-[3-(2,3-dihydroxypropoxy)propyl]benzaldehyde;yttrium (PubChem CID 158935762) has the molecular formula C14H21O4Y-
and a molecular weight of 342.22 g/mol. Its IUPAC name is carbanide;4-[3-(2,3-dihydroxypropoxy)propyl]benzaldehyde;yttrium.
Molecular Properties
| Compound Name | carbanide;4-[3-(2,3-dihydroxypropoxy)propyl]benzaldehyde;yttrium |
| PubChem CID | 158935762 |
| Molecular Formula | C14H21O4Y- |
| Molecular Weight | 342.22 g/mol |
| Exact Mass | 342.05 |
| IUPAC Name | carbanide;4-[3-(2,3-dihydroxypropoxy)propyl]benzaldehyde;yttrium |
| SMILES | O=Cc1ccc(CCCOCC(O)CO)cc1.[CH3-].[Y] |
| InChI | InChI=1S/C13H18O4.CH3.Y/c14-8-12-5-3-11(4-6-12)2-1-7-17-10-13(16)9-15;;/h3-6,8,13,15-16H,1-2,7,9-10H2;1H3;/q;-1; |
| InChIKey | XARCGXXFKXKCGU-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.22 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze carbanide;4-[3-(2,3-dihydroxypropoxy)propyl]benzaldehyde;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbanide;4-[3-(2,3-dihydroxypropoxy)propyl]benzaldehyde;yttrium?
The IUPAC name of carbanide;4-[3-(2,3-dihydroxypropoxy)propyl]benzaldehyde;yttrium (CID 158935762) is carbanide;4-[3-(2,3-dihydroxypropoxy)propyl]benzaldehyde;yttrium.
What is the SMILES notation for carbanide;4-[3-(2,3-dihydroxypropoxy)propyl]benzaldehyde;yttrium?
The canonical SMILES for carbanide;4-[3-(2,3-dihydroxypropoxy)propyl]benzaldehyde;yttrium is O=Cc1ccc(CCCOCC(O)CO)cc1.[CH3-].[Y].
What is the InChIKey of carbanide;4-[3-(2,3-dihydroxypropoxy)propyl]benzaldehyde;yttrium?
The InChIKey is XARCGXXFKXKCGU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18O4.CH3.Y/c14-8-12-5-3-11(4-6-12)2-1-7-17-10-13(16)9-15;;/h3-6,8,13,15-16H,1-2,7,9-10H2;1H3;/q;-1;.
What are the key properties of carbanide;4-[3-(2,3-dihydroxypropoxy)propyl]benzaldehyde;yttrium?
carbanide;4-[3-(2,3-dihydroxypropoxy)propyl]benzaldehyde;yttrium has a molecular weight of 342.22 g/mol, XLogP of 1.25, 8 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for carbanide;4-[3-(2,3-dihydroxypropoxy)propyl]benzaldehyde;yttrium is sourced from PubChem (CID 158935762), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).