C20H12Cl4N6 — CID 158936207
2-chloro-3-isocyano-6-methylpyridine;6-chloro-3-isocyano-2-methylpyridine;2,6-dichloro-3-isocyanopyridine (PubChem CID 158936207) has the molecular formula C20H12Cl4N6 and a molecular weight of 478.17 g/mol. Its IUPAC name is 2-chloro-3-isocyano-6-methylpyridine;6-chloro-3-isocyano-2-methylpyridine;2,6-dichloro-3-isocyanopyridine.
| Compound Name | 2-chloro-3-isocyano-6-methylpyridine;6-chloro-3-isocyano-2-methylpyridine;2,6-dichloro-3-isocyanopyridine |
|---|---|
| PubChem CID | 158936207 |
| Molecular Formula | C20H12Cl4N6 |
| Molecular Weight | 478.17 g/mol |
| Exact Mass | 475.99 |
| IUPAC Name | 2-chloro-3-isocyano-6-methylpyridine;6-chloro-3-isocyano-2-methylpyridine;2,6-dichloro-3-isocyanopyridine |
| SMILES | [C-]#[N+]c1ccc(C)nc1Cl.[C-]#[N+]c1ccc(Cl)nc1C.[C-]#[N+]c1ccc(Cl)nc1Cl |
| InChI | InChI=1S/2C7H5ClN2.C6H2Cl2N2/c1-5-6(9-2)3-4-7(8)10-5;1-5-3-4-6(9-2)7(8)10-5;1-9-4-2-3-5(7)10-6(4)8/h2*3-4H,1H3;2-3H |
| InChIKey | JJRIGBKDDFOKFW-UHFFFAOYSA-N |
| XLogP | 8.13 |
| TPSA | 51.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.17 |
| LogP ≤ 5 | 8.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|