About 2-phenyl-1H-benzimidazole;4-phenyl-1H-benzimidazole-2-sulfonic acid
2-phenyl-1H-benzimidazole;4-phenyl-1H-benzimidazole-2-sulfonic acid (PubChem CID 158936498) has the molecular formula C26H20N4O3S
and a molecular weight of 468.54 g/mol. Its IUPAC name is 2-phenyl-1H-benzimidazole;4-phenyl-1H-benzimidazole-2-sulfonic acid.
Molecular Properties
| Compound Name | 2-phenyl-1H-benzimidazole;4-phenyl-1H-benzimidazole-2-sulfonic acid |
| PubChem CID | 158936498 |
| Molecular Formula | C26H20N4O3S |
| Molecular Weight | 468.54 g/mol |
| Exact Mass | 468.13 |
| IUPAC Name | 2-phenyl-1H-benzimidazole;4-phenyl-1H-benzimidazole-2-sulfonic acid |
| SMILES | O=S(=O)(O)c1nc2c(-c3ccccc3)cccc2[nH]1.c1ccc(-c2nc3ccccc3[nH]2)cc1 |
| InChI | InChI=1S/C13H10N2O3S.C13H10N2/c16-19(17,18)13-14-11-8-4-7-10(12(11)15-13)9-5-2-1-3-6-9;1-2-6-10(7-3-1)13-14-11-8-4-5-9-12(11)15-13/h1-8H,(H,14,15)(H,16,17,18);1-9H,(H,14,15) |
| InChIKey | JJSFBQFGOSMYMN-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 111.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 468.54 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 2-phenyl-1H-benzimidazole;4-phenyl-1H-benzimidazole-2-sulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenyl-1H-benzimidazole;4-phenyl-1H-benzimidazole-2-sulfonic acid?
The IUPAC name of 2-phenyl-1H-benzimidazole;4-phenyl-1H-benzimidazole-2-sulfonic acid (CID 158936498) is 2-phenyl-1H-benzimidazole;4-phenyl-1H-benzimidazole-2-sulfonic acid.
What is the SMILES notation for 2-phenyl-1H-benzimidazole;4-phenyl-1H-benzimidazole-2-sulfonic acid?
The canonical SMILES for 2-phenyl-1H-benzimidazole;4-phenyl-1H-benzimidazole-2-sulfonic acid is O=S(=O)(O)c1nc2c(-c3ccccc3)cccc2[nH]1.c1ccc(-c2nc3ccccc3[nH]2)cc1.
What is the InChIKey of 2-phenyl-1H-benzimidazole;4-phenyl-1H-benzimidazole-2-sulfonic acid?
The InChIKey is JJSFBQFGOSMYMN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10N2O3S.C13H10N2/c16-19(17,18)13-14-11-8-4-7-10(12(11)15-13)9-5-2-1-3-6-9;1-2-6-10(7-3-1)13-14-11-8-4-5-9-12(11)15-13/h1-8H,(H,14,15)(H,16,17,18);1-9H,(H,14,15).
What are the key properties of 2-phenyl-1H-benzimidazole;4-phenyl-1H-benzimidazole-2-sulfonic acid?
2-phenyl-1H-benzimidazole;4-phenyl-1H-benzimidazole-2-sulfonic acid has a molecular weight of 468.54 g/mol, XLogP of 5.71, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenyl-1H-benzimidazole;4-phenyl-1H-benzimidazole-2-sulfonic acid is sourced from PubChem (CID 158936498), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).