C22H33ClN2O2 — CID 158937327
(2R)-2-amino-N-[(1R,5E)-6,10-dimethyl-4-oxo-1-phenylundeca-5,9-dienyl]propanamide;hydrochloride (PubChem CID 158937327) has the molecular formula C22H33ClN2O2 and a molecular weight of 392.97 g/mol. Its IUPAC name is (2R)-2-amino-N-[(1R,5E)-6,10-dimethyl-4-oxo-1-phenylundeca-5,9-dienyl]propanamide;hydrochloride.
| Compound Name | (2R)-2-amino-N-[(1R,5E)-6,10-dimethyl-4-oxo-1-phenylundeca-5,9-dienyl]propanamide;hydrochloride |
|---|---|
| PubChem CID | 158937327 |
| Molecular Formula | C22H33ClN2O2 |
| Molecular Weight | 392.97 g/mol |
| Exact Mass | 392.22 |
| IUPAC Name | (2R)-2-amino-N-[(1R,5E)-6,10-dimethyl-4-oxo-1-phenylundeca-5,9-dienyl]propanamide;hydrochloride |
| SMILES | CC(C)=CCC/C(C)=C/C(=O)CC[C@@H](NC(=O)[C@@H](C)N)c1ccccc1.Cl |
| InChI | InChI=1S/C22H32N2O2.ClH/c1-16(2)9-8-10-17(3)15-20(25)13-14-21(24-22(26)18(4)23)19-11-6-5-7-12-19;/h5-7,9,11-12,15,18,21H,8,10,13-14,23H2,1-4H3,(H,24,26);1H/b17-15+;/t18-,21-;/m1./s1 |
| InChIKey | CBTVASZJGSMZNN-NOBGRMIYSA-N |
| XLogP | 4.65 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.97 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|