C25H23FO5 — CID 158937411
carbon dioxide;(1S,2R,6S,7R,8S)-8-(4-fluorophenyl)-5-hydroxy-4-(2,4,6-trimethylphenyl)-10-oxatricyclo[5.2.1.02,6]dec-4-en-3-one (PubChem CID 158937411) has the molecular formula C25H23FO5 and a molecular weight of 422.45 g/mol. Its IUPAC name is carbon dioxide;(1S,2R,6S,7R,8S)-8-(4-fluorophenyl)-5-hydroxy-4-(2,4,6-trimethylphenyl)-10-oxatricyclo[5.2.1.02,6]dec-4-en-3-one.
| Compound Name | carbon dioxide;(1S,2R,6S,7R,8S)-8-(4-fluorophenyl)-5-hydroxy-4-(2,4,6-trimethylphenyl)-10-oxatricyclo[5.2.1.02,6]dec-4-en-3-one |
|---|---|
| PubChem CID | 158937411 |
| Molecular Formula | C25H23FO5 |
| Molecular Weight | 422.45 g/mol |
| Exact Mass | 422.15 |
| IUPAC Name | carbon dioxide;(1S,2R,6S,7R,8S)-8-(4-fluorophenyl)-5-hydroxy-4-(2,4,6-trimethylphenyl)-10-oxatricyclo[5.2.1.02,6]dec-4-en-3-one |
| SMILES | Cc1cc(C)c(C2=C(O)[C@@H]3[C@@H]4O[C@@H](C[C@H]4c4ccc(F)cc4)[C@@H]3C2=O)c(C)c1.O=C=O |
| InChI | InChI=1S/C24H23FO3.CO2/c1-11-8-12(2)18(13(3)9-11)20-22(26)19-17-10-16(14-4-6-15(25)7-5-14)24(28-17)21(19)23(20)27;2-1-3/h4-9,16-17,19,21,24,27H,10H2,1-3H3;/t16-,17-,19-,21+,24+;/m0./s1 |
| InChIKey | JJVAVCWZNCQFCE-VDQUOPQXSA-N |
| XLogP | 4.21 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.45 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |