C22H26O5SSi — CID 158937467
1-[4-[(2,5-dimethoxyphenyl)methylsulfonyl]phenyl]-4-trimethylsilylbut-3-yn-2-one (PubChem CID 158937467) has the molecular formula C22H26O5SSi and a molecular weight of 430.60 g/mol. Its IUPAC name is 1-[4-[(2,5-dimethoxyphenyl)methylsulfonyl]phenyl]-4-trimethylsilylbut-3-yn-2-one.
| Compound Name | 1-[4-[(2,5-dimethoxyphenyl)methylsulfonyl]phenyl]-4-trimethylsilylbut-3-yn-2-one |
|---|---|
| PubChem CID | 158937467 |
| Molecular Formula | C22H26O5SSi |
| Molecular Weight | 430.60 g/mol |
| Exact Mass | 430.13 |
| IUPAC Name | 1-[4-[(2,5-dimethoxyphenyl)methylsulfonyl]phenyl]-4-trimethylsilylbut-3-yn-2-one |
| SMILES | COc1ccc(OC)c(CS(=O)(=O)c2ccc(CC(=O)C#C[Si](C)(C)C)cc2)c1 |
| InChI | InChI=1S/C22H26O5SSi/c1-26-20-8-11-22(27-2)18(15-20)16-28(24,25)21-9-6-17(7-10-21)14-19(23)12-13-29(3,4)5/h6-11,15H,14,16H2,1-5H3 |
| InChIKey | JJVFGFWJHWRKOK-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.60 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|