C41H38N8O8 — CID 158941085
8-[2-(3,4-dimethoxyphenyl)ethynyl]-3-ethyl-7-methyl-1-prop-2-ynylpurine-2,6-dione;8-[2-(3,4-dimethoxyphenyl)ethynyl]-3-ethyl-1-prop-2-ynyl-7H-purine-2,6-dione (PubChem CID 158941085) has the molecular formula C41H38N8O8 and a molecular weight of 770.80 g/mol. Its IUPAC name is 8-[2-(3,4-dimethoxyphenyl)ethynyl]-3-ethyl-7-methyl-1-prop-2-ynylpurine-2,6-dione;8-[2-(3,4-dimethoxyphenyl)ethynyl]-3-ethyl-1-prop-2-ynyl-7H-purine-2,6-dione.
| Compound Name | 8-[2-(3,4-dimethoxyphenyl)ethynyl]-3-ethyl-7-methyl-1-prop-2-ynylpurine-2,6-dione;8-[2-(3,4-dimethoxyphenyl)ethynyl]-3-ethyl-1-prop-2-ynyl-7H-purine-2,6-dione |
|---|---|
| PubChem CID | 158941085 |
| Molecular Formula | C41H38N8O8 |
| Molecular Weight | 770.80 g/mol |
| Exact Mass | 770.28 |
| IUPAC Name | 8-[2-(3,4-dimethoxyphenyl)ethynyl]-3-ethyl-7-methyl-1-prop-2-ynylpurine-2,6-dione;8-[2-(3,4-dimethoxyphenyl)ethynyl]-3-ethyl-1-prop-2-ynyl-7H-purine-2,6-dione |
| SMILES | C#CCn1c(=O)c2[nH]c(C#Cc3ccc(OC)c(OC)c3)nc2n(CC)c1=O.C#CCn1c(=O)c2c(nc(C#Cc3ccc(OC)c(OC)c3)n2C)n(CC)c1=O |
| InChI | InChI=1S/C21H20N4O4.C20H18N4O4/c1-6-12-25-20(26)18-19(24(7-2)21(25)27)22-17(23(18)3)11-9-14-8-10-15(28-4)16(13-14)29-5;1-5-11-24-19(25)17-18(23(6-2)20(24)26)22-16(21-17)10-8-13-7-9-14(27-3)15(12-13)28-4/h1,8,10,13H,7,12H2,2-5H3;1,7,9,12H,6,11H2,2-4H3,(H,21,22) |
| InChIKey | JKGHVVOWSKPXEC-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 171.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 770.80 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|