About 2,2-dichloro-N-[5-(methylcarbamoylamino)pentyl]acetamide;propane
2,2-dichloro-N-[5-(methylcarbamoylamino)pentyl]acetamide;propane (PubChem CID 158941499) has the molecular formula C12H25Cl2N3O2
and a molecular weight of 314.26 g/mol. Its IUPAC name is 2,2-dichloro-N-[5-(methylcarbamoylamino)pentyl]acetamide;propane.
Molecular Properties
| Compound Name | 2,2-dichloro-N-[5-(methylcarbamoylamino)pentyl]acetamide;propane |
| PubChem CID | 158941499 |
| Molecular Formula | C12H25Cl2N3O2 |
| Molecular Weight | 314.26 g/mol |
| Exact Mass | 313.13 |
| IUPAC Name | 2,2-dichloro-N-[5-(methylcarbamoylamino)pentyl]acetamide;propane |
| SMILES | CCC.CNC(=O)NCCCCCNC(=O)C(Cl)Cl |
| InChI | InChI=1S/C9H17Cl2N3O2.C3H8/c1-12-9(16)14-6-4-2-3-5-13-8(15)7(10)11;1-3-2/h7H,2-6H2,1H3,(H,13,15)(H2,12,14,16);3H2,1-2H3 |
| InChIKey | JKHPFXHOZPUFCX-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.26 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2,2-dichloro-N-[5-(methylcarbamoylamino)pentyl]acetamide;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dichloro-N-[5-(methylcarbamoylamino)pentyl]acetamide;propane?
The IUPAC name of 2,2-dichloro-N-[5-(methylcarbamoylamino)pentyl]acetamide;propane (CID 158941499) is 2,2-dichloro-N-[5-(methylcarbamoylamino)pentyl]acetamide;propane.
What is the SMILES notation for 2,2-dichloro-N-[5-(methylcarbamoylamino)pentyl]acetamide;propane?
The canonical SMILES for 2,2-dichloro-N-[5-(methylcarbamoylamino)pentyl]acetamide;propane is CCC.CNC(=O)NCCCCCNC(=O)C(Cl)Cl.
What is the InChIKey of 2,2-dichloro-N-[5-(methylcarbamoylamino)pentyl]acetamide;propane?
The InChIKey is JKHPFXHOZPUFCX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17Cl2N3O2.C3H8/c1-12-9(16)14-6-4-2-3-5-13-8(15)7(10)11;1-3-2/h7H,2-6H2,1H3,(H,13,15)(H2,12,14,16);3H2,1-2H3.
What are the key properties of 2,2-dichloro-N-[5-(methylcarbamoylamino)pentyl]acetamide;propane?
2,2-dichloro-N-[5-(methylcarbamoylamino)pentyl]acetamide;propane has a molecular weight of 314.26 g/mol, XLogP of 2.42, 7 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dichloro-N-[5-(methylcarbamoylamino)pentyl]acetamide;propane is sourced from PubChem (CID 158941499), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).