C37H48O6 — CID 15894171
3,3,6,6-tetramethyl-9-[3-(3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-xanthen-9-yl)propyl]-4,5,7,9-tetrahydro-2H-xanthene-1,8-dione (PubChem CID 15894171) has the molecular formula C37H48O6 and a molecular weight of 588.79 g/mol. Its IUPAC name is 3,3,6,6-tetramethyl-9-[3-(3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-xanthen-9-yl)propyl]-4,5,7,9-tetrahydro-2H-xanthene-1,8-dione.
| Compound Name | 3,3,6,6-tetramethyl-9-[3-(3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-xanthen-9-yl)propyl]-4,5,7,9-tetrahydro-2H-xanthene-1,8-dione |
|---|---|
| PubChem CID | 15894171 |
| Molecular Formula | C37H48O6 |
| Molecular Weight | 588.79 g/mol |
| Exact Mass | 588.35 |
| IUPAC Name | 3,3,6,6-tetramethyl-9-[3-(3,3,6,6-tetramethyl-1,8-dioxo-4,5,7,9-tetrahydro-2H-xanthen-9-yl)propyl]-4,5,7,9-tetrahydro-2H-xanthene-1,8-dione |
| SMILES | CC1(C)CC(=O)C2=C(C1)OC1=C(C(=O)CC(C)(C)C1)C2CCCC1C2=C(CC(C)(C)CC2=O)OC2=C1C(=O)CC(C)(C)C2 |
| InChI | InChI=1S/C37H48O6/c1-34(2)12-22(38)30-20(31-23(39)13-35(3,4)17-27(31)42-26(30)16-34)10-9-11-21-32-24(40)14-36(5,6)18-28(32)43-29-19-37(7,8)15-25(41)33(21)29/h20-21H,9-19H2,1-8H3 |
| InChIKey | RYQYSYMCWPVANU-UHFFFAOYSA-N |
| XLogP | 8.02 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.79 |
| LogP ≤ 5 | 8.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |