About 5-[4,4-bis(hydroxymethyl)piperidin-1-yl]-7-oxo-8H-isoquinoline-6-carbonitrile
5-[4,4-bis(hydroxymethyl)piperidin-1-yl]-7-oxo-8H-isoquinoline-6-carbonitrile (PubChem CID 158942637) has the molecular formula C17H19N3O3
and a molecular weight of 313.36 g/mol. Its IUPAC name is 5-[4,4-bis(hydroxymethyl)piperidin-1-yl]-7-oxo-8H-isoquinoline-6-carbonitrile.
Molecular Properties
| Compound Name | 5-[4,4-bis(hydroxymethyl)piperidin-1-yl]-7-oxo-8H-isoquinoline-6-carbonitrile |
| PubChem CID | 158942637 |
| Molecular Formula | C17H19N3O3 |
| Molecular Weight | 313.36 g/mol |
| Exact Mass | 313.14 |
| IUPAC Name | 5-[4,4-bis(hydroxymethyl)piperidin-1-yl]-7-oxo-8H-isoquinoline-6-carbonitrile |
| SMILES | N#CC1=C(N2CCC(CO)(CO)CC2)c2ccncc2CC1=O |
| InChI | InChI=1S/C17H19N3O3/c18-8-14-15(23)7-12-9-19-4-1-13(12)16(14)20-5-2-17(10-21,11-22)3-6-20/h1,4,9,21-22H,2-3,5-7,10-11H2 |
| InChIKey | SCVSZYRDQBPEGU-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 97.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.36 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-[4,4-bis(hydroxymethyl)piperidin-1-yl]-7-oxo-8H-isoquinoline-6-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[4,4-bis(hydroxymethyl)piperidin-1-yl]-7-oxo-8H-isoquinoline-6-carbonitrile?
The IUPAC name of 5-[4,4-bis(hydroxymethyl)piperidin-1-yl]-7-oxo-8H-isoquinoline-6-carbonitrile (CID 158942637) is 5-[4,4-bis(hydroxymethyl)piperidin-1-yl]-7-oxo-8H-isoquinoline-6-carbonitrile.
What is the SMILES notation for 5-[4,4-bis(hydroxymethyl)piperidin-1-yl]-7-oxo-8H-isoquinoline-6-carbonitrile?
The canonical SMILES for 5-[4,4-bis(hydroxymethyl)piperidin-1-yl]-7-oxo-8H-isoquinoline-6-carbonitrile is N#CC1=C(N2CCC(CO)(CO)CC2)c2ccncc2CC1=O.
What is the InChIKey of 5-[4,4-bis(hydroxymethyl)piperidin-1-yl]-7-oxo-8H-isoquinoline-6-carbonitrile?
The InChIKey is SCVSZYRDQBPEGU-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19N3O3/c18-8-14-15(23)7-12-9-19-4-1-13(12)16(14)20-5-2-17(10-21,11-22)3-6-20/h1,4,9,21-22H,2-3,5-7,10-11H2.
What are the key properties of 5-[4,4-bis(hydroxymethyl)piperidin-1-yl]-7-oxo-8H-isoquinoline-6-carbonitrile?
5-[4,4-bis(hydroxymethyl)piperidin-1-yl]-7-oxo-8H-isoquinoline-6-carbonitrile has a molecular weight of 313.36 g/mol, XLogP of 0.51, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[4,4-bis(hydroxymethyl)piperidin-1-yl]-7-oxo-8H-isoquinoline-6-carbonitrile is sourced from PubChem (CID 158942637), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).