About pyridine-2-sulfonyl chloride;1,3-thiazole-2-sulfonyl chloride
pyridine-2-sulfonyl chloride;1,3-thiazole-2-sulfonyl chloride (PubChem CID 158943193) has the molecular formula C8H6Cl2N2O4S3
and a molecular weight of 361.25 g/mol. Its IUPAC name is pyridine-2-sulfonyl chloride;1,3-thiazole-2-sulfonyl chloride.
Molecular Properties
| Compound Name | pyridine-2-sulfonyl chloride;1,3-thiazole-2-sulfonyl chloride |
| PubChem CID | 158943193 |
| Molecular Formula | C8H6Cl2N2O4S3 |
| Molecular Weight | 361.25 g/mol |
| Exact Mass | 359.89 |
| IUPAC Name | pyridine-2-sulfonyl chloride;1,3-thiazole-2-sulfonyl chloride |
| SMILES | O=S(=O)(Cl)c1ccccn1.O=S(=O)(Cl)c1nccs1 |
| InChI | InChI=1S/C5H4ClNO2S.C3H2ClNO2S2/c6-10(8,9)5-3-1-2-4-7-5;4-9(6,7)3-5-1-2-8-3/h1-4H;1-2H |
| InChIKey | JKMWNAHSUJAZHY-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 94.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 361.25 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze pyridine-2-sulfonyl chloride;1,3-thiazole-2-sulfonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyridine-2-sulfonyl chloride;1,3-thiazole-2-sulfonyl chloride?
The IUPAC name of pyridine-2-sulfonyl chloride;1,3-thiazole-2-sulfonyl chloride (CID 158943193) is pyridine-2-sulfonyl chloride;1,3-thiazole-2-sulfonyl chloride.
What is the SMILES notation for pyridine-2-sulfonyl chloride;1,3-thiazole-2-sulfonyl chloride?
The canonical SMILES for pyridine-2-sulfonyl chloride;1,3-thiazole-2-sulfonyl chloride is O=S(=O)(Cl)c1ccccn1.O=S(=O)(Cl)c1nccs1.
What is the InChIKey of pyridine-2-sulfonyl chloride;1,3-thiazole-2-sulfonyl chloride?
The InChIKey is JKMWNAHSUJAZHY-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H4ClNO2S.C3H2ClNO2S2/c6-10(8,9)5-3-1-2-4-7-5;4-9(6,7)3-5-1-2-8-3/h1-4H;1-2H.
What are the key properties of pyridine-2-sulfonyl chloride;1,3-thiazole-2-sulfonyl chloride?
pyridine-2-sulfonyl chloride;1,3-thiazole-2-sulfonyl chloride has a molecular weight of 361.25 g/mol, XLogP of 2.08, 2 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for pyridine-2-sulfonyl chloride;1,3-thiazole-2-sulfonyl chloride is sourced from PubChem (CID 158943193), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).