About (2R)-2-[(4-aminocyclohexyl)amino]-3,3,3-trifluoropropan-1-ol;molecular hydrogen
(2R)-2-[(4-aminocyclohexyl)amino]-3,3,3-trifluoropropan-1-ol;molecular hydrogen (PubChem CID 158943513) has the molecular formula C9H19F3N2O
and a molecular weight of 228.26 g/mol. Its IUPAC name is (2R)-2-[(4-aminocyclohexyl)amino]-3,3,3-trifluoropropan-1-ol;molecular hydrogen.
Molecular Properties
| Compound Name | (2R)-2-[(4-aminocyclohexyl)amino]-3,3,3-trifluoropropan-1-ol;molecular hydrogen |
| PubChem CID | 158943513 |
| Molecular Formula | C9H19F3N2O |
| Molecular Weight | 228.26 g/mol |
| Exact Mass | 228.14 |
| IUPAC Name | (2R)-2-[(4-aminocyclohexyl)amino]-3,3,3-trifluoropropan-1-ol;molecular hydrogen |
| SMILES | NC1CCC(N[C@H](CO)C(F)(F)F)CC1.[H][H] |
| InChI | InChI=1S/C9H17F3N2O.H2/c10-9(11,12)8(5-15)14-7-3-1-6(13)2-4-7;/h6-8,14-15H,1-5,13H2;1H/t6?,7?,8-;/m1./s1 |
| InChIKey | JKNVDPNNPGSABJ-XJRLSETOSA-N |
| XLogP | 1.02 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.26 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2R)-2-[(4-aminocyclohexyl)amino]-3,3,3-trifluoropropan-1-ol;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-[(4-aminocyclohexyl)amino]-3,3,3-trifluoropropan-1-ol;molecular hydrogen?
The IUPAC name of (2R)-2-[(4-aminocyclohexyl)amino]-3,3,3-trifluoropropan-1-ol;molecular hydrogen (CID 158943513) is (2R)-2-[(4-aminocyclohexyl)amino]-3,3,3-trifluoropropan-1-ol;molecular hydrogen.
What is the SMILES notation for (2R)-2-[(4-aminocyclohexyl)amino]-3,3,3-trifluoropropan-1-ol;molecular hydrogen?
The canonical SMILES for (2R)-2-[(4-aminocyclohexyl)amino]-3,3,3-trifluoropropan-1-ol;molecular hydrogen is NC1CCC(N[C@H](CO)C(F)(F)F)CC1.[H][H].
What is the InChIKey of (2R)-2-[(4-aminocyclohexyl)amino]-3,3,3-trifluoropropan-1-ol;molecular hydrogen?
The InChIKey is JKNVDPNNPGSABJ-XJRLSETOSA-N. The full InChI is InChI=1S/C9H17F3N2O.H2/c10-9(11,12)8(5-15)14-7-3-1-6(13)2-4-7;/h6-8,14-15H,1-5,13H2;1H/t6?,7?,8-;/m1./s1.
What are the key properties of (2R)-2-[(4-aminocyclohexyl)amino]-3,3,3-trifluoropropan-1-ol;molecular hydrogen?
(2R)-2-[(4-aminocyclohexyl)amino]-3,3,3-trifluoropropan-1-ol;molecular hydrogen has a molecular weight of 228.26 g/mol, XLogP of 1.02, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-[(4-aminocyclohexyl)amino]-3,3,3-trifluoropropan-1-ol;molecular hydrogen is sourced from PubChem (CID 158943513), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).