C30H44O4 — CID 15894363
(2R)-2-[(3S,5R,10S,13R,14R,17R)-3-hydroxy-4,4,10,13,14-pentamethyl-16-oxo-1,2,3,5,6,12,15,17-octahydrocyclopenta[a]phenanthren-17-yl]-6-methylhept-5-enoic acid (PubChem CID 15894363) has the molecular formula C30H44O4 and a molecular weight of 468.68 g/mol. Its IUPAC name is (2R)-2-[(3S,5R,10S,13R,14R,17R)-3-hydroxy-4,4,10,13,14-pentamethyl-16-oxo-1,2,3,5,6,12,15,17-octahydrocyclopenta[a]phenanthren-17-yl]-6-methylhept-5-enoic acid.
| Compound Name | (2R)-2-[(3S,5R,10S,13R,14R,17R)-3-hydroxy-4,4,10,13,14-pentamethyl-16-oxo-1,2,3,5,6,12,15,17-octahydrocyclopenta[a]phenanthren-17-yl]-6-methylhept-5-enoic acid |
|---|---|
| PubChem CID | 15894363 |
| Molecular Formula | C30H44O4 |
| Molecular Weight | 468.68 g/mol |
| Exact Mass | 468.32 |
| IUPAC Name | (2R)-2-[(3S,5R,10S,13R,14R,17R)-3-hydroxy-4,4,10,13,14-pentamethyl-16-oxo-1,2,3,5,6,12,15,17-octahydrocyclopenta[a]phenanthren-17-yl]-6-methylhept-5-enoic acid |
| SMILES | CC(C)=CCC[C@@H](C(=O)O)[C@H]1C(=O)C[C@@]2(C)C3=CC[C@H]4C(C)(C)[C@@H](O)CC[C@]4(C)C3=CC[C@]12C |
| InChI | InChI=1S/C30H44O4/c1-18(2)9-8-10-19(26(33)34)25-22(31)17-30(7)21-11-12-23-27(3,4)24(32)14-15-28(23,5)20(21)13-16-29(25,30)6/h9,11,13,19,23-25,32H,8,10,12,14-17H2,1-7H3,(H,33,34)/t19-,23+,24+,25+,28-,29-,30+/m1/s1 |
| InChIKey | ZILGTWWGYWOZLX-YJAYWBJASA-N |
| XLogP | 6.50 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.68 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|