About 4-bromobenzene-1,2-diamine;4-chlorobenzene-1,2-diamine
4-bromobenzene-1,2-diamine;4-chlorobenzene-1,2-diamine (PubChem CID 158945320) has the molecular formula C12H14BrClN4
and a molecular weight of 329.63 g/mol. Its IUPAC name is 4-bromobenzene-1,2-diamine;4-chlorobenzene-1,2-diamine.
Molecular Properties
| Compound Name | 4-bromobenzene-1,2-diamine;4-chlorobenzene-1,2-diamine |
| PubChem CID | 158945320 |
| Molecular Formula | C12H14BrClN4 |
| Molecular Weight | 329.63 g/mol |
| Exact Mass | 328.01 |
| IUPAC Name | 4-bromobenzene-1,2-diamine;4-chlorobenzene-1,2-diamine |
| SMILES | Nc1ccc(Br)cc1N.Nc1ccc(Cl)cc1N |
| InChI | InChI=1S/C6H7BrN2.C6H7ClN2/c2*7-4-1-2-5(8)6(9)3-4/h2*1-3H,8-9H2 |
| InChIKey | JKTFEJGSZBVIAY-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 104.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.63 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-bromobenzene-1,2-diamine;4-chlorobenzene-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromobenzene-1,2-diamine;4-chlorobenzene-1,2-diamine?
The IUPAC name of 4-bromobenzene-1,2-diamine;4-chlorobenzene-1,2-diamine (CID 158945320) is 4-bromobenzene-1,2-diamine;4-chlorobenzene-1,2-diamine.
What is the SMILES notation for 4-bromobenzene-1,2-diamine;4-chlorobenzene-1,2-diamine?
The canonical SMILES for 4-bromobenzene-1,2-diamine;4-chlorobenzene-1,2-diamine is Nc1ccc(Br)cc1N.Nc1ccc(Cl)cc1N.
What is the InChIKey of 4-bromobenzene-1,2-diamine;4-chlorobenzene-1,2-diamine?
The InChIKey is JKTFEJGSZBVIAY-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7BrN2.C6H7ClN2/c2*7-4-1-2-5(8)6(9)3-4/h2*1-3H,8-9H2.
What are the key properties of 4-bromobenzene-1,2-diamine;4-chlorobenzene-1,2-diamine?
4-bromobenzene-1,2-diamine;4-chlorobenzene-1,2-diamine has a molecular weight of 329.63 g/mol, XLogP of 3.12, 0 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromobenzene-1,2-diamine;4-chlorobenzene-1,2-diamine is sourced from PubChem (CID 158945320), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).