C4H12O6 — CID 158946660
ethane-1,1,1-triol;methoxymethanediol (PubChem CID 158946660) has the molecular formula C4H12O6 and a molecular weight of 156.13 g/mol. Its IUPAC name is ethane-1,1,1-triol;methoxymethanediol.
| Compound Name | ethane-1,1,1-triol;methoxymethanediol |
|---|---|
| PubChem CID | 158946660 |
| Molecular Formula | C4H12O6 |
| Molecular Weight | 156.13 g/mol |
| Exact Mass | 156.06 |
| IUPAC Name | ethane-1,1,1-triol;methoxymethanediol |
| SMILES | CC(O)(O)O.COC(O)O |
| InChI | InChI=1S/2C2H6O3/c1-5-2(3)4;1-2(3,4)5/h2-4H,1H3;3-5H,1H3 |
| InChIKey | JKXFPXDNLZEAMO-UHFFFAOYSA-N |
| XLogP | -2.46 |
| TPSA | 110.38 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.13 |
| LogP ≤ 5 | -2.46 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|