About ethane-1,1,1-triol;methoxymethanediol
ethane-1,1,1-triol;methoxymethanediol (PubChem CID 158946660) has the molecular formula C4H12O6
and a molecular weight of 156.13 g/mol. Its IUPAC name is ethane-1,1,1-triol;methoxymethanediol.
Molecular Properties
| Compound Name | ethane-1,1,1-triol;methoxymethanediol |
| PubChem CID | 158946660 |
| Molecular Formula | C4H12O6 |
| Molecular Weight | 156.13 g/mol |
| Exact Mass | 156.06 |
| IUPAC Name | ethane-1,1,1-triol;methoxymethanediol |
| SMILES | CC(O)(O)O.COC(O)O |
| InChI | InChI=1S/2C2H6O3/c1-5-2(3)4;1-2(3,4)5/h2-4H,1H3;3-5H,1H3 |
| InChIKey | JKXFPXDNLZEAMO-UHFFFAOYSA-N |
| XLogP | -2.46 |
| TPSA | 110.38 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.13 |
| LogP ≤ 5 | -2.46 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze ethane-1,1,1-triol;methoxymethanediol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane-1,1,1-triol;methoxymethanediol?
The IUPAC name of ethane-1,1,1-triol;methoxymethanediol (CID 158946660) is ethane-1,1,1-triol;methoxymethanediol.
What is the SMILES notation for ethane-1,1,1-triol;methoxymethanediol?
The canonical SMILES for ethane-1,1,1-triol;methoxymethanediol is CC(O)(O)O.COC(O)O.
What is the InChIKey of ethane-1,1,1-triol;methoxymethanediol?
The InChIKey is JKXFPXDNLZEAMO-UHFFFAOYSA-N. The full InChI is InChI=1S/2C2H6O3/c1-5-2(3)4;1-2(3,4)5/h2-4H,1H3;3-5H,1H3.
What are the key properties of ethane-1,1,1-triol;methoxymethanediol?
ethane-1,1,1-triol;methoxymethanediol has a molecular weight of 156.13 g/mol, XLogP of -2.46, 1 rotatable bonds, 5 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethane-1,1,1-triol;methoxymethanediol is sourced from PubChem (CID 158946660), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).