C31H41F3N4O3Si — CID 158948775
2-[2-[2-(cyclohexen-1-yl)-4-piperidin-4-ylphenyl]acetyl]-1-(2-trimethylsilylethoxymethyl)imidazole-4-carbonitrile;2,2,2-trifluoroacetaldehyde (PubChem CID 158948775) has the molecular formula C31H41F3N4O3Si and a molecular weight of 602.77 g/mol. Its IUPAC name is 2-[2-[2-(cyclohexen-1-yl)-4-piperidin-4-ylphenyl]acetyl]-1-(2-trimethylsilylethoxymethyl)imidazole-4-carbonitrile;2,2,2-trifluoroacetaldehyde.
| Compound Name | 2-[2-[2-(cyclohexen-1-yl)-4-piperidin-4-ylphenyl]acetyl]-1-(2-trimethylsilylethoxymethyl)imidazole-4-carbonitrile;2,2,2-trifluoroacetaldehyde |
|---|---|
| PubChem CID | 158948775 |
| Molecular Formula | C31H41F3N4O3Si |
| Molecular Weight | 602.77 g/mol |
| Exact Mass | 602.29 |
| IUPAC Name | 2-[2-[2-(cyclohexen-1-yl)-4-piperidin-4-ylphenyl]acetyl]-1-(2-trimethylsilylethoxymethyl)imidazole-4-carbonitrile;2,2,2-trifluoroacetaldehyde |
| SMILES | C[Si](C)(C)CCOCn1cc(C#N)nc1C(=O)Cc1ccc(C2CCNCC2)cc1C1=CCCCC1.O=CC(F)(F)F |
| InChI | InChI=1S/C29H40N4O2Si.C2HF3O/c1-36(2,3)16-15-35-21-33-20-26(19-30)32-29(33)28(34)18-25-10-9-24(22-11-13-31-14-12-22)17-27(25)23-7-5-4-6-8-23;3-2(4,5)1-6/h7,9-10,17,20,22,31H,4-6,8,11-16,18,21H2,1-3H3;1H |
| InChIKey | JLDSQPXFNMMMTG-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 97.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.77 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|