About diphenylmethanone;2-propan-2-ylthioxanthen-9-one
diphenylmethanone;2-propan-2-ylthioxanthen-9-one (PubChem CID 158949201) has the molecular formula C29H24O2S
and a molecular weight of 436.58 g/mol. Its IUPAC name is diphenylmethanone;2-propan-2-ylthioxanthen-9-one.
Molecular Properties
| Compound Name | diphenylmethanone;2-propan-2-ylthioxanthen-9-one |
| PubChem CID | 158949201 |
| Molecular Formula | C29H24O2S |
| Molecular Weight | 436.58 g/mol |
| Exact Mass | 436.15 |
| IUPAC Name | diphenylmethanone;2-propan-2-ylthioxanthen-9-one |
| SMILES | CC(C)c1ccc2sc3ccccc3c(=O)c2c1.O=C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C16H14OS.C13H10O/c1-10(2)11-7-8-15-13(9-11)16(17)12-5-3-4-6-14(12)18-15;14-13(11-7-3-1-4-8-11)12-9-5-2-6-10-12/h3-10H,1-2H3;1-10H |
| InChIKey | JLFCAEOZPSPRHX-UHFFFAOYSA-N |
| XLogP | 7.46 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 436.58 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze diphenylmethanone;2-propan-2-ylthioxanthen-9-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diphenylmethanone;2-propan-2-ylthioxanthen-9-one?
The IUPAC name of diphenylmethanone;2-propan-2-ylthioxanthen-9-one (CID 158949201) is diphenylmethanone;2-propan-2-ylthioxanthen-9-one.
What is the SMILES notation for diphenylmethanone;2-propan-2-ylthioxanthen-9-one?
The canonical SMILES for diphenylmethanone;2-propan-2-ylthioxanthen-9-one is CC(C)c1ccc2sc3ccccc3c(=O)c2c1.O=C(c1ccccc1)c1ccccc1.
What is the InChIKey of diphenylmethanone;2-propan-2-ylthioxanthen-9-one?
The InChIKey is JLFCAEOZPSPRHX-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14OS.C13H10O/c1-10(2)11-7-8-15-13(9-11)16(17)12-5-3-4-6-14(12)18-15;14-13(11-7-3-1-4-8-11)12-9-5-2-6-10-12/h3-10H,1-2H3;1-10H.
What are the key properties of diphenylmethanone;2-propan-2-ylthioxanthen-9-one?
diphenylmethanone;2-propan-2-ylthioxanthen-9-one has a molecular weight of 436.58 g/mol, XLogP of 7.46, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for diphenylmethanone;2-propan-2-ylthioxanthen-9-one is sourced from PubChem (CID 158949201), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).