About N,N-bis(2-ethylhexyl)-2,2-dimethylpropanamide
N,N-bis(2-ethylhexyl)-2,2-dimethylpropanamide (PubChem CID 15894971) has the molecular formula C21H43NO
and a molecular weight of 325.58 g/mol. Its IUPAC name is N,N-bis(2-ethylhexyl)-2,2-dimethylpropanamide.
Molecular Properties
| Compound Name | N,N-bis(2-ethylhexyl)-2,2-dimethylpropanamide |
| PubChem CID | 15894971 |
| Molecular Formula | C21H43NO |
| Molecular Weight | 325.58 g/mol |
| Exact Mass | 325.33 |
| IUPAC Name | N,N-bis(2-ethylhexyl)-2,2-dimethylpropanamide |
| SMILES | CCCCC(CC)CN(CC(CC)CCCC)C(=O)C(C)(C)C |
| InChI | InChI=1S/C21H43NO/c1-8-12-14-18(10-3)16-22(20(23)21(5,6)7)17-19(11-4)15-13-9-2/h18-19H,8-17H2,1-7H3 |
| InChIKey | ODFOPGYFSLHCQS-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 325.58 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N,N-bis(2-ethylhexyl)-2,2-dimethylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-bis(2-ethylhexyl)-2,2-dimethylpropanamide?
The IUPAC name of N,N-bis(2-ethylhexyl)-2,2-dimethylpropanamide (CID 15894971) is N,N-bis(2-ethylhexyl)-2,2-dimethylpropanamide.
What is the SMILES notation for N,N-bis(2-ethylhexyl)-2,2-dimethylpropanamide?
The canonical SMILES for N,N-bis(2-ethylhexyl)-2,2-dimethylpropanamide is CCCCC(CC)CN(CC(CC)CCCC)C(=O)C(C)(C)C.
What is the InChIKey of N,N-bis(2-ethylhexyl)-2,2-dimethylpropanamide?
The InChIKey is ODFOPGYFSLHCQS-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H43NO/c1-8-12-14-18(10-3)16-22(20(23)21(5,6)7)17-19(11-4)15-13-9-2/h18-19H,8-17H2,1-7H3.
What are the key properties of N,N-bis(2-ethylhexyl)-2,2-dimethylpropanamide?
N,N-bis(2-ethylhexyl)-2,2-dimethylpropanamide has a molecular weight of 325.58 g/mol, XLogP of 6.29, 12 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-bis(2-ethylhexyl)-2,2-dimethylpropanamide is sourced from PubChem (CID 15894971), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).