C9H12F3NO5S — CID 158955604
2-[(2S)-pyrrolidine-2-carbonyl]sulfanylacetic acid;2,2,2-trifluoroacetic acid (PubChem CID 158955604) has the molecular formula C9H12F3NO5S and a molecular weight of 303.26 g/mol. Its IUPAC name is 2-[(2S)-pyrrolidine-2-carbonyl]sulfanylacetic acid;2,2,2-trifluoroacetic acid.
| Compound Name | 2-[(2S)-pyrrolidine-2-carbonyl]sulfanylacetic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 158955604 |
| Molecular Formula | C9H12F3NO5S |
| Molecular Weight | 303.26 g/mol |
| Exact Mass | 303.04 |
| IUPAC Name | 2-[(2S)-pyrrolidine-2-carbonyl]sulfanylacetic acid;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.O=C(O)CSC(=O)[C@@H]1CCCN1 |
| InChI | InChI=1S/C7H11NO3S.C2HF3O2/c9-6(10)4-12-7(11)5-2-1-3-8-5;3-2(4,5)1(6)7/h5,8H,1-4H2,(H,9,10);(H,6,7)/t5-;/m0./s1 |
| InChIKey | JLYSXSAVLDRHTR-JEDNCBNOSA-N |
| XLogP | 0.72 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.26 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|