About benzene;carbonic acid;cyclohexanamine
benzene;carbonic acid;cyclohexanamine (PubChem CID 158956378) has the molecular formula C13H21NO3
and a molecular weight of 239.32 g/mol. Its IUPAC name is benzene;carbonic acid;cyclohexanamine.
Molecular Properties
| Compound Name | benzene;carbonic acid;cyclohexanamine |
| PubChem CID | 158956378 |
| Molecular Formula | C13H21NO3 |
| Molecular Weight | 239.32 g/mol |
| Exact Mass | 239.15 |
| IUPAC Name | benzene;carbonic acid;cyclohexanamine |
| SMILES | NC1CCCCC1.O=C(O)O.c1ccccc1 |
| InChI | InChI=1S/C6H13N.C6H6.CH2O3/c7-6-4-2-1-3-5-6;1-2-4-6-5-3-1;2-1(3)4/h6H,1-5,7H2;1-6H;(H2,2,3,4) |
| InChIKey | JMBBFFCKENUYSQ-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.32 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze benzene;carbonic acid;cyclohexanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzene;carbonic acid;cyclohexanamine?
The IUPAC name of benzene;carbonic acid;cyclohexanamine (CID 158956378) is benzene;carbonic acid;cyclohexanamine.
What is the SMILES notation for benzene;carbonic acid;cyclohexanamine?
The canonical SMILES for benzene;carbonic acid;cyclohexanamine is NC1CCCCC1.O=C(O)O.c1ccccc1.
What is the InChIKey of benzene;carbonic acid;cyclohexanamine?
The InChIKey is JMBBFFCKENUYSQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13N.C6H6.CH2O3/c7-6-4-2-1-3-5-6;1-2-4-6-5-3-1;2-1(3)4/h6H,1-5,7H2;1-6H;(H2,2,3,4).
What are the key properties of benzene;carbonic acid;cyclohexanamine?
benzene;carbonic acid;cyclohexanamine has a molecular weight of 239.32 g/mol, XLogP of 3.19, 0 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for benzene;carbonic acid;cyclohexanamine is sourced from PubChem (CID 158956378), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).