About 6-hydroxy-2,4,4-trimethyl-3-[(4-methylphenyl)sulfonylmethyl]cyclohex-2-en-1-one
6-hydroxy-2,4,4-trimethyl-3-[(4-methylphenyl)sulfonylmethyl]cyclohex-2-en-1-one (PubChem CID 15895673) has the molecular formula C17H22O4S
and a molecular weight of 322.43 g/mol. Its IUPAC name is 6-hydroxy-2,4,4-trimethyl-3-[(4-methylphenyl)sulfonylmethyl]cyclohex-2-en-1-one.
Molecular Properties
| Compound Name | 6-hydroxy-2,4,4-trimethyl-3-[(4-methylphenyl)sulfonylmethyl]cyclohex-2-en-1-one |
| PubChem CID | 15895673 |
| Molecular Formula | C17H22O4S |
| Molecular Weight | 322.43 g/mol |
| Exact Mass | 322.12 |
| IUPAC Name | 6-hydroxy-2,4,4-trimethyl-3-[(4-methylphenyl)sulfonylmethyl]cyclohex-2-en-1-one |
| SMILES | CC1=C(CS(=O)(=O)c2ccc(C)cc2)C(C)(C)CC(O)C1=O |
| InChI | InChI=1S/C17H22O4S/c1-11-5-7-13(8-6-11)22(20,21)10-14-12(2)16(19)15(18)9-17(14,3)4/h5-8,15,18H,9-10H2,1-4H3 |
| InChIKey | QJXVQUNBIHBEQC-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.43 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-hydroxy-2,4,4-trimethyl-3-[(4-methylphenyl)sulfonylmethyl]cyclohex-2-en-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-hydroxy-2,4,4-trimethyl-3-[(4-methylphenyl)sulfonylmethyl]cyclohex-2-en-1-one?
The IUPAC name of 6-hydroxy-2,4,4-trimethyl-3-[(4-methylphenyl)sulfonylmethyl]cyclohex-2-en-1-one (CID 15895673) is 6-hydroxy-2,4,4-trimethyl-3-[(4-methylphenyl)sulfonylmethyl]cyclohex-2-en-1-one.
What is the SMILES notation for 6-hydroxy-2,4,4-trimethyl-3-[(4-methylphenyl)sulfonylmethyl]cyclohex-2-en-1-one?
The canonical SMILES for 6-hydroxy-2,4,4-trimethyl-3-[(4-methylphenyl)sulfonylmethyl]cyclohex-2-en-1-one is CC1=C(CS(=O)(=O)c2ccc(C)cc2)C(C)(C)CC(O)C1=O.
What is the InChIKey of 6-hydroxy-2,4,4-trimethyl-3-[(4-methylphenyl)sulfonylmethyl]cyclohex-2-en-1-one?
The InChIKey is QJXVQUNBIHBEQC-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H22O4S/c1-11-5-7-13(8-6-11)22(20,21)10-14-12(2)16(19)15(18)9-17(14,3)4/h5-8,15,18H,9-10H2,1-4H3.
What are the key properties of 6-hydroxy-2,4,4-trimethyl-3-[(4-methylphenyl)sulfonylmethyl]cyclohex-2-en-1-one?
6-hydroxy-2,4,4-trimethyl-3-[(4-methylphenyl)sulfonylmethyl]cyclohex-2-en-1-one has a molecular weight of 322.43 g/mol, XLogP of 2.45, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-hydroxy-2,4,4-trimethyl-3-[(4-methylphenyl)sulfonylmethyl]cyclohex-2-en-1-one is sourced from PubChem (CID 15895673), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).