About hexan-2-one;pentan-2-one;phenyl N-methylcarbamate
hexan-2-one;pentan-2-one;phenyl N-methylcarbamate (PubChem CID 158958417) has the molecular formula C19H31NO4
and a molecular weight of 337.46 g/mol. Its IUPAC name is hexan-2-one;pentan-2-one;phenyl N-methylcarbamate.
Molecular Properties
| Compound Name | hexan-2-one;pentan-2-one;phenyl N-methylcarbamate |
| PubChem CID | 158958417 |
| Molecular Formula | C19H31NO4 |
| Molecular Weight | 337.46 g/mol |
| Exact Mass | 337.23 |
| IUPAC Name | hexan-2-one;pentan-2-one;phenyl N-methylcarbamate |
| SMILES | CCCC(C)=O.CCCCC(C)=O.CNC(=O)Oc1ccccc1 |
| InChI | InChI=1S/C8H9NO2.C6H12O.C5H10O/c1-9-8(10)11-7-5-3-2-4-6-7;1-3-4-5-6(2)7;1-3-4-5(2)6/h2-6H,1H3,(H,9,10);3-5H2,1-2H3;3-4H2,1-2H3 |
| InChIKey | JMHQIFZASKIARO-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.46 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze hexan-2-one;pentan-2-one;phenyl N-methylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hexan-2-one;pentan-2-one;phenyl N-methylcarbamate?
The IUPAC name of hexan-2-one;pentan-2-one;phenyl N-methylcarbamate (CID 158958417) is hexan-2-one;pentan-2-one;phenyl N-methylcarbamate.
What is the SMILES notation for hexan-2-one;pentan-2-one;phenyl N-methylcarbamate?
The canonical SMILES for hexan-2-one;pentan-2-one;phenyl N-methylcarbamate is CCCC(C)=O.CCCCC(C)=O.CNC(=O)Oc1ccccc1.
What is the InChIKey of hexan-2-one;pentan-2-one;phenyl N-methylcarbamate?
The InChIKey is JMHQIFZASKIARO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9NO2.C6H12O.C5H10O/c1-9-8(10)11-7-5-3-2-4-6-7;1-3-4-5-6(2)7;1-3-4-5(2)6/h2-6H,1H3,(H,9,10);3-5H2,1-2H3;3-4H2,1-2H3.
What are the key properties of hexan-2-one;pentan-2-one;phenyl N-methylcarbamate?
hexan-2-one;pentan-2-one;phenyl N-methylcarbamate has a molecular weight of 337.46 g/mol, XLogP of 4.55, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for hexan-2-one;pentan-2-one;phenyl N-methylcarbamate is sourced from PubChem (CID 158958417), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).