About tert-butyl 2-(4,4-dimethylpentyl)quinoline-4-carboxylate;carbon dioxide
tert-butyl 2-(4,4-dimethylpentyl)quinoline-4-carboxylate;carbon dioxide (PubChem CID 158959353) has the molecular formula C22H29NO4
and a molecular weight of 371.48 g/mol. Its IUPAC name is tert-butyl 2-(4,4-dimethylpentyl)quinoline-4-carboxylate;carbon dioxide.
Molecular Properties
| Compound Name | tert-butyl 2-(4,4-dimethylpentyl)quinoline-4-carboxylate;carbon dioxide |
| PubChem CID | 158959353 |
| Molecular Formula | C22H29NO4 |
| Molecular Weight | 371.48 g/mol |
| Exact Mass | 371.21 |
| IUPAC Name | tert-butyl 2-(4,4-dimethylpentyl)quinoline-4-carboxylate;carbon dioxide |
| SMILES | CC(C)(C)CCCc1cc(C(=O)OC(C)(C)C)c2ccccc2n1.O=C=O |
| InChI | InChI=1S/C21H29NO2.CO2/c1-20(2,3)13-9-10-15-14-17(19(23)24-21(4,5)6)16-11-7-8-12-18(16)22-15;2-1-3/h7-8,11-12,14H,9-10,13H2,1-6H3; |
| InChIKey | JMKNVVYMUVRXML-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 73.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 371.48 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze tert-butyl 2-(4,4-dimethylpentyl)quinoline-4-carboxylate;carbon dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 2-(4,4-dimethylpentyl)quinoline-4-carboxylate;carbon dioxide?
The IUPAC name of tert-butyl 2-(4,4-dimethylpentyl)quinoline-4-carboxylate;carbon dioxide (CID 158959353) is tert-butyl 2-(4,4-dimethylpentyl)quinoline-4-carboxylate;carbon dioxide.
What is the SMILES notation for tert-butyl 2-(4,4-dimethylpentyl)quinoline-4-carboxylate;carbon dioxide?
The canonical SMILES for tert-butyl 2-(4,4-dimethylpentyl)quinoline-4-carboxylate;carbon dioxide is CC(C)(C)CCCc1cc(C(=O)OC(C)(C)C)c2ccccc2n1.O=C=O.
What is the InChIKey of tert-butyl 2-(4,4-dimethylpentyl)quinoline-4-carboxylate;carbon dioxide?
The InChIKey is JMKNVVYMUVRXML-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H29NO2.CO2/c1-20(2,3)13-9-10-15-14-17(19(23)24-21(4,5)6)16-11-7-8-12-18(16)22-15;2-1-3/h7-8,11-12,14H,9-10,13H2,1-6H3;.
What are the key properties of tert-butyl 2-(4,4-dimethylpentyl)quinoline-4-carboxylate;carbon dioxide?
tert-butyl 2-(4,4-dimethylpentyl)quinoline-4-carboxylate;carbon dioxide has a molecular weight of 371.48 g/mol, XLogP of 4.98, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 2-(4,4-dimethylpentyl)quinoline-4-carboxylate;carbon dioxide is sourced from PubChem (CID 158959353), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).