C18H22O4 — CID 15896037
[(4aR,5R,6S)-3,4a,5,9-tetramethyl-2-oxo-4,5,6,7-tetrahydrobenzo[f][1]benzofuran-6-yl] acetate (PubChem CID 15896037) has the molecular formula C18H22O4 and a molecular weight of 302.37 g/mol. Its IUPAC name is [(4aR,5R,6S)-3,4a,5,9-tetramethyl-2-oxo-4,5,6,7-tetrahydrobenzo[f][1]benzofuran-6-yl] acetate.
| Compound Name | [(4aR,5R,6S)-3,4a,5,9-tetramethyl-2-oxo-4,5,6,7-tetrahydrobenzo[f][1]benzofuran-6-yl] acetate |
|---|---|
| PubChem CID | 15896037 |
| Molecular Formula | C18H22O4 |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.15 |
| IUPAC Name | [(4aR,5R,6S)-3,4a,5,9-tetramethyl-2-oxo-4,5,6,7-tetrahydrobenzo[f][1]benzofuran-6-yl] acetate |
| SMILES | CC(=O)O[C@H]1CC=C2C(C)=C3OC(=O)C(C)=C3C[C@]2(C)[C@H]1C |
| InChI | InChI=1S/C18H22O4/c1-9-13-8-18(5)11(3)15(21-12(4)19)7-6-14(18)10(2)16(13)22-17(9)20/h6,11,15H,7-8H2,1-5H3/t11-,15-,18+/m0/s1 |
| InChIKey | RAZRQGVYIGGVHQ-GEWABHDNSA-N |
| XLogP | 3.44 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |