C13H5F3O6S — CID 15896246
(2,4-dioxo-3-oxatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaen-7-yl) trifluoromethanesulfonate (PubChem CID 15896246) has the molecular formula C13H5F3O6S and a molecular weight of 346.24 g/mol. Its IUPAC name is (2,4-dioxo-3-oxatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaen-7-yl) trifluoromethanesulfonate.
| Compound Name | (2,4-dioxo-3-oxatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaen-7-yl) trifluoromethanesulfonate |
|---|---|
| PubChem CID | 15896246 |
| Molecular Formula | C13H5F3O6S |
| Molecular Weight | 346.24 g/mol |
| Exact Mass | 345.98 |
| IUPAC Name | (2,4-dioxo-3-oxatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaen-7-yl) trifluoromethanesulfonate |
| SMILES | O=C1OC(=O)c2cc(OS(=O)(=O)C(F)(F)F)cc3cccc1c23 |
| InChI | InChI=1S/C13H5F3O6S/c14-13(15,16)23(19,20)22-7-4-6-2-1-3-8-10(6)9(5-7)12(18)21-11(8)17/h1-5H |
| InChIKey | INUBTIVQGAFTFQ-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.24 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|