About 2-tert-butyl-1-methylpiperidin-4-one;bis(3-tert-butyl-1-propan-2-ylcyclohexan-1-ol)
2-tert-butyl-1-methylpiperidin-4-one;bis(3-tert-butyl-1-propan-2-ylcyclohexan-1-ol) (PubChem CID 158962745) has the molecular formula C36H71NO3
and a molecular weight of 565.97 g/mol. Its IUPAC name is 2-tert-butyl-1-methylpiperidin-4-one;bis(3-tert-butyl-1-propan-2-ylcyclohexan-1-ol).
Molecular Properties
| Compound Name | 2-tert-butyl-1-methylpiperidin-4-one;bis(3-tert-butyl-1-propan-2-ylcyclohexan-1-ol) |
| PubChem CID | 158962745 |
| Molecular Formula | C36H71NO3 |
| Molecular Weight | 565.97 g/mol |
| Exact Mass | 565.54 |
| IUPAC Name | 2-tert-butyl-1-methylpiperidin-4-one;bis(3-tert-butyl-1-propan-2-ylcyclohexan-1-ol) |
| SMILES | CC(C)C1(O)CCCC(C(C)(C)C)C1.CC(C)C1(O)CCCC(C(C)(C)C)C1.CN1CCC(=O)CC1C(C)(C)C |
| InChI | InChI=1S/2C13H26O.C10H19NO/c2*1-10(2)13(14)8-6-7-11(9-13)12(3,4)5;1-10(2,3)9-7-8(12)5-6-11(9)4/h2*10-11,14H,6-9H2,1-5H3;9H,5-7H2,1-4H3 |
| InChIKey | JMVBZTRCRPUUQG-UHFFFAOYSA-N |
| XLogP | 8.92 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 40 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 565.97 |
| LogP ≤ 5 | 8.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-tert-butyl-1-methylpiperidin-4-one;bis(3-tert-butyl-1-propan-2-ylcyclohexan-1-ol) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-tert-butyl-1-methylpiperidin-4-one;bis(3-tert-butyl-1-propan-2-ylcyclohexan-1-ol)?
The IUPAC name of 2-tert-butyl-1-methylpiperidin-4-one;bis(3-tert-butyl-1-propan-2-ylcyclohexan-1-ol) (CID 158962745) is 2-tert-butyl-1-methylpiperidin-4-one;bis(3-tert-butyl-1-propan-2-ylcyclohexan-1-ol).
What is the SMILES notation for 2-tert-butyl-1-methylpiperidin-4-one;bis(3-tert-butyl-1-propan-2-ylcyclohexan-1-ol)?
The canonical SMILES for 2-tert-butyl-1-methylpiperidin-4-one;bis(3-tert-butyl-1-propan-2-ylcyclohexan-1-ol) is CC(C)C1(O)CCCC(C(C)(C)C)C1.CC(C)C1(O)CCCC(C(C)(C)C)C1.CN1CCC(=O)CC1C(C)(C)C.
What is the InChIKey of 2-tert-butyl-1-methylpiperidin-4-one;bis(3-tert-butyl-1-propan-2-ylcyclohexan-1-ol)?
The InChIKey is JMVBZTRCRPUUQG-UHFFFAOYSA-N. The full InChI is InChI=1S/2C13H26O.C10H19NO/c2*1-10(2)13(14)8-6-7-11(9-13)12(3,4)5;1-10(2,3)9-7-8(12)5-6-11(9)4/h2*10-11,14H,6-9H2,1-5H3;9H,5-7H2,1-4H3.
What are the key properties of 2-tert-butyl-1-methylpiperidin-4-one;bis(3-tert-butyl-1-propan-2-ylcyclohexan-1-ol)?
2-tert-butyl-1-methylpiperidin-4-one;bis(3-tert-butyl-1-propan-2-ylcyclohexan-1-ol) has a molecular weight of 565.97 g/mol, XLogP of 8.92, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-tert-butyl-1-methylpiperidin-4-one;bis(3-tert-butyl-1-propan-2-ylcyclohexan-1-ol) is sourced from PubChem (CID 158962745), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).