C18H19IO2 — CID 15896337
(E)-1-[2-[(Z)-6-iodohex-3-enyl]-4-methoxyphenyl]pent-1-en-4-yn-3-one (PubChem CID 15896337) has the molecular formula C18H19IO2 and a molecular weight of 394.25 g/mol. Its IUPAC name is (E)-1-[2-[(Z)-6-iodohex-3-enyl]-4-methoxyphenyl]pent-1-en-4-yn-3-one.
| Compound Name | (E)-1-[2-[(Z)-6-iodohex-3-enyl]-4-methoxyphenyl]pent-1-en-4-yn-3-one |
|---|---|
| PubChem CID | 15896337 |
| Molecular Formula | C18H19IO2 |
| Molecular Weight | 394.25 g/mol |
| Exact Mass | 394.04 |
| IUPAC Name | (E)-1-[2-[(Z)-6-iodohex-3-enyl]-4-methoxyphenyl]pent-1-en-4-yn-3-one |
| SMILES | C#CC(=O)/C=C/c1ccc(OC)cc1CC/C=C\CCI |
| InChI | InChI=1S/C18H19IO2/c1-3-17(20)11-9-15-10-12-18(21-2)14-16(15)8-6-4-5-7-13-19/h1,4-5,9-12,14H,6-8,13H2,2H3/b5-4-,11-9+ |
| InChIKey | DPADUBDPEOSQIN-JHGYFVHDSA-N |
| XLogP | 4.22 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.25 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_2', 'substructure': 'N/A'} |
|---|