C8H11F3O — CID 15896422
(3R)-4,4,5-trifluoro-6-methylhepta-1,5-dien-3-ol (PubChem CID 15896422) has the molecular formula C8H11F3O and a molecular weight of 180.17 g/mol. Its IUPAC name is (3R)-4,4,5-trifluoro-6-methylhepta-1,5-dien-3-ol.
| Compound Name | (3R)-4,4,5-trifluoro-6-methylhepta-1,5-dien-3-ol |
|---|---|
| PubChem CID | 15896422 |
| Molecular Formula | C8H11F3O |
| Molecular Weight | 180.17 g/mol |
| Exact Mass | 180.08 |
| IUPAC Name | (3R)-4,4,5-trifluoro-6-methylhepta-1,5-dien-3-ol |
| SMILES | C=C[C@@H](O)C(F)(F)C(F)=C(C)C |
| InChI | InChI=1S/C8H11F3O/c1-4-6(12)8(10,11)7(9)5(2)3/h4,6,12H,1H2,2-3H3/t6-/m1/s1 |
| InChIKey | WVEBTIVCNHLAHX-ZCFIWIBFSA-N |
| XLogP | 2.43 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.17 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|