About 1-methylpiperidine-3-carbaldehyde;1-methyl-3-[(E)-prop-1-enyl]piperidine
1-methylpiperidine-3-carbaldehyde;1-methyl-3-[(E)-prop-1-enyl]piperidine (PubChem CID 158965677) has the molecular formula C16H30N2O
and a molecular weight of 266.43 g/mol. Its IUPAC name is 1-methylpiperidine-3-carbaldehyde;1-methyl-3-[(E)-prop-1-enyl]piperidine.
Molecular Properties
| Compound Name | 1-methylpiperidine-3-carbaldehyde;1-methyl-3-[(E)-prop-1-enyl]piperidine |
| PubChem CID | 158965677 |
| Molecular Formula | C16H30N2O |
| Molecular Weight | 266.43 g/mol |
| Exact Mass | 266.24 |
| IUPAC Name | 1-methylpiperidine-3-carbaldehyde;1-methyl-3-[(E)-prop-1-enyl]piperidine |
| SMILES | C/C=C/C1CCCN(C)C1.CN1CCCC(C=O)C1 |
| InChI | InChI=1S/C9H17N.C7H13NO/c1-3-5-9-6-4-7-10(2)8-9;1-8-4-2-3-7(5-8)6-9/h3,5,9H,4,6-8H2,1-2H3;6-7H,2-5H2,1H3/b5-3+; |
| InChIKey | JNEAVUKMQDLWAV-WGCWOXMQSA-N |
| XLogP | 2.43 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.43 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-methylpiperidine-3-carbaldehyde;1-methyl-3-[(E)-prop-1-enyl]piperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methylpiperidine-3-carbaldehyde;1-methyl-3-[(E)-prop-1-enyl]piperidine?
The IUPAC name of 1-methylpiperidine-3-carbaldehyde;1-methyl-3-[(E)-prop-1-enyl]piperidine (CID 158965677) is 1-methylpiperidine-3-carbaldehyde;1-methyl-3-[(E)-prop-1-enyl]piperidine.
What is the SMILES notation for 1-methylpiperidine-3-carbaldehyde;1-methyl-3-[(E)-prop-1-enyl]piperidine?
The canonical SMILES for 1-methylpiperidine-3-carbaldehyde;1-methyl-3-[(E)-prop-1-enyl]piperidine is C/C=C/C1CCCN(C)C1.CN1CCCC(C=O)C1.
What is the InChIKey of 1-methylpiperidine-3-carbaldehyde;1-methyl-3-[(E)-prop-1-enyl]piperidine?
The InChIKey is JNEAVUKMQDLWAV-WGCWOXMQSA-N. The full InChI is InChI=1S/C9H17N.C7H13NO/c1-3-5-9-6-4-7-10(2)8-9;1-8-4-2-3-7(5-8)6-9/h3,5,9H,4,6-8H2,1-2H3;6-7H,2-5H2,1H3/b5-3+;.
What are the key properties of 1-methylpiperidine-3-carbaldehyde;1-methyl-3-[(E)-prop-1-enyl]piperidine?
1-methylpiperidine-3-carbaldehyde;1-methyl-3-[(E)-prop-1-enyl]piperidine has a molecular weight of 266.43 g/mol, XLogP of 2.43, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methylpiperidine-3-carbaldehyde;1-methyl-3-[(E)-prop-1-enyl]piperidine is sourced from PubChem (CID 158965677), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).