C35H71N5O4 — CID 158966345
tert-butyl (3R,5R)-3,5-dimethylpiperidine-1-carboxylate;tert-butyl (3S,5S)-3,5-dimethyl-4-propan-2-ylpiperazine-1-carboxylate;(2S,6S)-2,6-dimethyl-1-propan-2-ylpiperazine (PubChem CID 158966345) has the molecular formula C35H71N5O4 and a molecular weight of 625.98 g/mol. Its IUPAC name is tert-butyl (3R,5R)-3,5-dimethylpiperidine-1-carboxylate;tert-butyl (3S,5S)-3,5-dimethyl-4-propan-2-ylpiperazine-1-carboxylate;(2S,6S)-2,6-dimethyl-1-propan-2-ylpiperazine.
| Compound Name | tert-butyl (3R,5R)-3,5-dimethylpiperidine-1-carboxylate;tert-butyl (3S,5S)-3,5-dimethyl-4-propan-2-ylpiperazine-1-carboxylate;(2S,6S)-2,6-dimethyl-1-propan-2-ylpiperazine |
|---|---|
| PubChem CID | 158966345 |
| Molecular Formula | C35H71N5O4 |
| Molecular Weight | 625.98 g/mol |
| Exact Mass | 625.55 |
| IUPAC Name | tert-butyl (3R,5R)-3,5-dimethylpiperidine-1-carboxylate;tert-butyl (3S,5S)-3,5-dimethyl-4-propan-2-ylpiperazine-1-carboxylate;(2S,6S)-2,6-dimethyl-1-propan-2-ylpiperazine |
| SMILES | CC(C)N1[C@@H](C)CN(C(=O)OC(C)(C)C)C[C@@H]1C.CC(C)N1[C@@H](C)CNC[C@@H]1C.C[C@@H]1C[C@@H](C)CN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C14H28N2O2.C12H23NO2.C9H20N2/c1-10(2)16-11(3)8-15(9-12(16)4)13(17)18-14(5,6)7;1-9-6-10(2)8-13(7-9)11(14)15-12(3,4)5;1-7(2)11-8(3)5-10-6-9(11)4/h10-12H,8-9H2,1-7H3;9-10H,6-8H2,1-5H3;7-10H,5-6H2,1-4H3/t11-,12-;9-,10-;8-,9-/m010/s1 |
| InChIKey | JNGFSBLGZRSAPZ-AQNTYPBLSA-N |
| XLogP | 6.70 |
| TPSA | 77.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.98 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |