C18H16ClF3N2O — CID 158966557
1-[(2S)-1-(4-chlorophenyl)pyrrolidin-2-yl]-2-[5-(trifluoromethyl)-2-pyridinyl]ethanone (PubChem CID 158966557) has the molecular formula C18H16ClF3N2O and a molecular weight of 368.79 g/mol. Its IUPAC name is 1-[(2S)-1-(4-chlorophenyl)pyrrolidin-2-yl]-2-[5-(trifluoromethyl)-2-pyridinyl]ethanone.
| Compound Name | 1-[(2S)-1-(4-chlorophenyl)pyrrolidin-2-yl]-2-[5-(trifluoromethyl)-2-pyridinyl]ethanone |
|---|---|
| PubChem CID | 158966557 |
| Molecular Formula | C18H16ClF3N2O |
| Molecular Weight | 368.79 g/mol |
| Exact Mass | 368.09 |
| IUPAC Name | 1-[(2S)-1-(4-chlorophenyl)pyrrolidin-2-yl]-2-[5-(trifluoromethyl)-2-pyridinyl]ethanone |
| SMILES | O=C(Cc1ccc(C(F)(F)F)cn1)[C@@H]1CCCN1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H16ClF3N2O/c19-13-4-7-15(8-5-13)24-9-1-2-16(24)17(25)10-14-6-3-12(11-23-14)18(20,21)22/h3-8,11,16H,1-2,9-10H2/t16-/m0/s1 |
| InChIKey | RYSCDOGYDPQBNZ-INIZCTEOSA-N |
| XLogP | 4.53 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.79 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |