About 1-methyl-3-phenyl-2H-imidazole;quinoline
1-methyl-3-phenyl-2H-imidazole;quinoline (PubChem CID 158967107) has the molecular formula C19H19N3
and a molecular weight of 289.38 g/mol. Its IUPAC name is 1-methyl-3-phenyl-2H-imidazole;quinoline.
Molecular Properties
| Compound Name | 1-methyl-3-phenyl-2H-imidazole;quinoline |
| PubChem CID | 158967107 |
| Molecular Formula | C19H19N3 |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.16 |
| IUPAC Name | 1-methyl-3-phenyl-2H-imidazole;quinoline |
| SMILES | CN1C=CN(c2ccccc2)C1.c1ccc2ncccc2c1 |
| InChI | InChI=1S/C10H12N2.C9H7N/c1-11-7-8-12(9-11)10-5-3-2-4-6-10;1-2-6-9-8(4-1)5-3-7-10-9/h2-8H,9H2,1H3;1-7H |
| InChIKey | JNIPOSRYRFTRKJ-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-methyl-3-phenyl-2H-imidazole;quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-3-phenyl-2H-imidazole;quinoline?
The IUPAC name of 1-methyl-3-phenyl-2H-imidazole;quinoline (CID 158967107) is 1-methyl-3-phenyl-2H-imidazole;quinoline.
What is the SMILES notation for 1-methyl-3-phenyl-2H-imidazole;quinoline?
The canonical SMILES for 1-methyl-3-phenyl-2H-imidazole;quinoline is CN1C=CN(c2ccccc2)C1.c1ccc2ncccc2c1.
What is the InChIKey of 1-methyl-3-phenyl-2H-imidazole;quinoline?
The InChIKey is JNIPOSRYRFTRKJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N2.C9H7N/c1-11-7-8-12(9-11)10-5-3-2-4-6-10;1-2-6-9-8(4-1)5-3-7-10-9/h2-8H,9H2,1H3;1-7H.
What are the key properties of 1-methyl-3-phenyl-2H-imidazole;quinoline?
1-methyl-3-phenyl-2H-imidazole;quinoline has a molecular weight of 289.38 g/mol, XLogP of 4.10, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-3-phenyl-2H-imidazole;quinoline is sourced from PubChem (CID 158967107), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).