C36H52BrN3O4Si2 — CID 158967282
methyl 4-[5-bromo-1-(2-trimethylsilylethoxymethyl)benzimidazol-2-yl]-4-[5,6,7-trimethyl-1-(2-trimethylsilylethoxymethyl)indol-4-yl]pent-2-enoate (PubChem CID 158967282) has the molecular formula C36H52BrN3O4Si2 and a molecular weight of 726.90 g/mol. Its IUPAC name is methyl 4-[5-bromo-1-(2-trimethylsilylethoxymethyl)benzimidazol-2-yl]-4-[5,6,7-trimethyl-1-(2-trimethylsilylethoxymethyl)indol-4-yl]pent-2-enoate.
| Compound Name | methyl 4-[5-bromo-1-(2-trimethylsilylethoxymethyl)benzimidazol-2-yl]-4-[5,6,7-trimethyl-1-(2-trimethylsilylethoxymethyl)indol-4-yl]pent-2-enoate |
|---|---|
| PubChem CID | 158967282 |
| Molecular Formula | C36H52BrN3O4Si2 |
| Molecular Weight | 726.90 g/mol |
| Exact Mass | 725.27 |
| IUPAC Name | methyl 4-[5-bromo-1-(2-trimethylsilylethoxymethyl)benzimidazol-2-yl]-4-[5,6,7-trimethyl-1-(2-trimethylsilylethoxymethyl)indol-4-yl]pent-2-enoate |
| SMILES | COC(=O)C=CC(C)(c1c(C)c(C)c(C)c2c1ccn2COCC[Si](C)(C)C)c1nc2cc(Br)ccc2n1COCC[Si](C)(C)C |
| InChI | InChI=1S/C36H52BrN3O4Si2/c1-25-26(2)33(29-15-17-39(34(29)27(25)3)23-43-18-20-45(6,7)8)36(4,16-14-32(41)42-5)35-38-30-22-28(37)12-13-31(30)40(35)24-44-19-21-46(9,10)11/h12-17,22H,18-21,23-24H2,1-11H3 |
| InChIKey | ZTCHNRODAVFBOY-UHFFFAOYSA-N |
| XLogP | 9.34 |
| TPSA | 67.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 726.90 |
| LogP ≤ 5 | 9.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|