C13H24N2O2 — CID 158969228
1-N,1-N,3-N,3-N,5-pentamethylcyclohexane-1,3-dicarboxamide (PubChem CID 158969228) has the molecular formula C13H24N2O2 and a molecular weight of 240.35 g/mol. Its IUPAC name is 1-N,1-N,3-N,3-N,5-pentamethylcyclohexane-1,3-dicarboxamide.
| Compound Name | 1-N,1-N,3-N,3-N,5-pentamethylcyclohexane-1,3-dicarboxamide |
|---|---|
| PubChem CID | 158969228 |
| Molecular Formula | C13H24N2O2 |
| Molecular Weight | 240.35 g/mol |
| Exact Mass | 240.18 |
| IUPAC Name | 1-N,1-N,3-N,3-N,5-pentamethylcyclohexane-1,3-dicarboxamide |
| SMILES | CC1CC(C(=O)N(C)C)CC(C(=O)N(C)C)C1 |
| InChI | InChI=1S/C13H24N2O2/c1-9-6-10(12(16)14(2)3)8-11(7-9)13(17)15(4)5/h9-11H,6-8H2,1-5H3 |
| InChIKey | KLSBAGVPHOUWLO-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.35 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |