About 4-[dichloro(methyl)silyl]butanenitrile;4-[difluoro(methyl)silyl]butanenitrile;methane
4-[dichloro(methyl)silyl]butanenitrile;4-[difluoro(methyl)silyl]butanenitrile;methane (PubChem CID 158969718) has the molecular formula C11H22Cl2F2N2Si2
and a molecular weight of 347.39 g/mol. Its IUPAC name is 4-[dichloro(methyl)silyl]butanenitrile;4-[difluoro(methyl)silyl]butanenitrile;methane.
Molecular Properties
| Compound Name | 4-[dichloro(methyl)silyl]butanenitrile;4-[difluoro(methyl)silyl]butanenitrile;methane |
| PubChem CID | 158969718 |
| Molecular Formula | C11H22Cl2F2N2Si2 |
| Molecular Weight | 347.39 g/mol |
| Exact Mass | 346.07 |
| IUPAC Name | 4-[dichloro(methyl)silyl]butanenitrile;4-[difluoro(methyl)silyl]butanenitrile;methane |
| SMILES | C.C[Si](Cl)(Cl)CCCC#N.C[Si](F)(F)CCCC#N |
| InChI | InChI=1S/C5H9Cl2NSi.C5H9F2NSi.CH4/c2*1-9(6,7)5-3-2-4-8;/h2*2-3,5H2,1H3;1H4 |
| InChIKey | JNQOJQPVFMKQDS-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 347.39 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|
Analyze 4-[dichloro(methyl)silyl]butanenitrile;4-[difluoro(methyl)silyl]butanenitrile;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[dichloro(methyl)silyl]butanenitrile;4-[difluoro(methyl)silyl]butanenitrile;methane?
The IUPAC name of 4-[dichloro(methyl)silyl]butanenitrile;4-[difluoro(methyl)silyl]butanenitrile;methane (CID 158969718) is 4-[dichloro(methyl)silyl]butanenitrile;4-[difluoro(methyl)silyl]butanenitrile;methane.
What is the SMILES notation for 4-[dichloro(methyl)silyl]butanenitrile;4-[difluoro(methyl)silyl]butanenitrile;methane?
The canonical SMILES for 4-[dichloro(methyl)silyl]butanenitrile;4-[difluoro(methyl)silyl]butanenitrile;methane is C.C[Si](Cl)(Cl)CCCC#N.C[Si](F)(F)CCCC#N.
What is the InChIKey of 4-[dichloro(methyl)silyl]butanenitrile;4-[difluoro(methyl)silyl]butanenitrile;methane?
The InChIKey is JNQOJQPVFMKQDS-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9Cl2NSi.C5H9F2NSi.CH4/c2*1-9(6,7)5-3-2-4-8;/h2*2-3,5H2,1H3;1H4.
What are the key properties of 4-[dichloro(methyl)silyl]butanenitrile;4-[difluoro(methyl)silyl]butanenitrile;methane?
4-[dichloro(methyl)silyl]butanenitrile;4-[difluoro(methyl)silyl]butanenitrile;methane has a molecular weight of 347.39 g/mol, XLogP of 5.78, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[dichloro(methyl)silyl]butanenitrile;4-[difluoro(methyl)silyl]butanenitrile;methane is sourced from PubChem (CID 158969718), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).