C32H45BrN2O8 — CID 158969893
tert-butyl N-[(1R,2R)-5-bromo-2-hydroxy-2,3-dihydro-1H-inden-1-yl]carbamate;ethyl (1R,2R)-2-hydroxy-1-[(2-methylpropan-2-yl)oxycarbonylamino]-2,3-dihydro-1H-indene-5-carboxylate;methane (PubChem CID 158969893) has the molecular formula C32H45BrN2O8 and a molecular weight of 665.62 g/mol. Its IUPAC name is tert-butyl N-[(1R,2R)-5-bromo-2-hydroxy-2,3-dihydro-1H-inden-1-yl]carbamate;ethyl (1R,2R)-2-hydroxy-1-[(2-methylpropan-2-yl)oxycarbonylamino]-2,3-dihydro-1H-indene-5-carboxylate;methane.
| Compound Name | tert-butyl N-[(1R,2R)-5-bromo-2-hydroxy-2,3-dihydro-1H-inden-1-yl]carbamate;ethyl (1R,2R)-2-hydroxy-1-[(2-methylpropan-2-yl)oxycarbonylamino]-2,3-dihydro-1H-indene-5-carboxylate;methane |
|---|---|
| PubChem CID | 158969893 |
| Molecular Formula | C32H45BrN2O8 |
| Molecular Weight | 665.62 g/mol |
| Exact Mass | 664.24 |
| IUPAC Name | tert-butyl N-[(1R,2R)-5-bromo-2-hydroxy-2,3-dihydro-1H-inden-1-yl]carbamate;ethyl (1R,2R)-2-hydroxy-1-[(2-methylpropan-2-yl)oxycarbonylamino]-2,3-dihydro-1H-indene-5-carboxylate;methane |
| SMILES | C.CC(C)(C)OC(=O)N[C@@H]1c2ccc(Br)cc2C[C@H]1O.CCOC(=O)c1ccc2c(c1)C[C@@H](O)[C@@H]2NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H23NO5.C14H18BrNO3.CH4/c1-5-22-15(20)10-6-7-12-11(8-10)9-13(19)14(12)18-16(21)23-17(2,3)4;1-14(2,3)19-13(18)16-12-10-5-4-9(15)6-8(10)7-11(12)17;/h6-8,13-14,19H,5,9H2,1-4H3,(H,18,21);4-6,11-12,17H,7H2,1-3H3,(H,16,18);1H4/t13-,14-;11-,12-;/m11./s1 |
| InChIKey | JNRCBUHUUJUSMD-CGZGNFDTSA-N |
| XLogP | 5.91 |
| TPSA | 143.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.62 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|