About 3-ethynylbenzoic acid
3-ethynylbenzoic acid (PubChem CID 15897047) has the molecular formula C9H6O2
and a molecular weight of 146.14 g/mol. Its IUPAC name is 3-ethynylbenzoic acid.
Molecular Properties
| Compound Name | 3-ethynylbenzoic acid |
| PubChem CID | 15897047 |
| Molecular Formula | C9H6O2 |
| Molecular Weight | 146.14 g/mol |
| Exact Mass | 146.04 |
| IUPAC Name | 3-ethynylbenzoic acid |
| SMILES | C#Cc1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C9H6O2/c1-2-7-4-3-5-8(6-7)9(10)11/h1,3-6H,(H,10,11) |
| InChIKey | PHPIMLZTBYCDSX-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.14 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-ethynylbenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethynylbenzoic acid?
The IUPAC name of 3-ethynylbenzoic acid (CID 15897047) is 3-ethynylbenzoic acid.
What is the SMILES notation for 3-ethynylbenzoic acid?
The canonical SMILES for 3-ethynylbenzoic acid is C#Cc1cccc(C(=O)O)c1.
What is the InChIKey of 3-ethynylbenzoic acid?
The InChIKey is PHPIMLZTBYCDSX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6O2/c1-2-7-4-3-5-8(6-7)9(10)11/h1,3-6H,(H,10,11).
What are the key properties of 3-ethynylbenzoic acid?
3-ethynylbenzoic acid has a molecular weight of 146.14 g/mol, XLogP of 1.37, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethynylbenzoic acid is sourced from PubChem (CID 15897047), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).