C21H16O11S2 — CID 158970507
3,4-dihydroxynaphthalene-1-sulfonic acid;3-hydroxy-7-sulfonaphthalene-2-carboxylic acid (PubChem CID 158970507) has the molecular formula C21H16O11S2 and a molecular weight of 508.48 g/mol. Its IUPAC name is 3,4-dihydroxynaphthalene-1-sulfonic acid;3-hydroxy-7-sulfonaphthalene-2-carboxylic acid.
| Compound Name | 3,4-dihydroxynaphthalene-1-sulfonic acid;3-hydroxy-7-sulfonaphthalene-2-carboxylic acid |
|---|---|
| PubChem CID | 158970507 |
| Molecular Formula | C21H16O11S2 |
| Molecular Weight | 508.48 g/mol |
| Exact Mass | 508.01 |
| IUPAC Name | 3,4-dihydroxynaphthalene-1-sulfonic acid;3-hydroxy-7-sulfonaphthalene-2-carboxylic acid |
| SMILES | O=C(O)c1cc2cc(S(=O)(=O)O)ccc2cc1O.O=S(=O)(O)c1cc(O)c(O)c2ccccc12 |
| InChI | InChI=1S/C11H8O6S.C10H8O5S/c12-10-5-6-1-2-8(18(15,16)17)3-7(6)4-9(10)11(13)14;11-8-5-9(16(13,14)15)6-3-1-2-4-7(6)10(8)12/h1-5,12H,(H,13,14)(H,15,16,17);1-5,11-12H,(H,13,14,15) |
| InChIKey | JNTGPMGYFCZPGS-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 206.73 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.48 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|