C32H38Br2O2Si2 — CID 158971127
1,3-dibromo-5-phenylmethoxybenzene;trimethyl-(3-phenylmethoxy-5-trimethylsilylphenyl)silane (PubChem CID 158971127) has the molecular formula C32H38Br2O2Si2 and a molecular weight of 670.63 g/mol. Its IUPAC name is 1,3-dibromo-5-phenylmethoxybenzene;trimethyl-(3-phenylmethoxy-5-trimethylsilylphenyl)silane.
| Compound Name | 1,3-dibromo-5-phenylmethoxybenzene;trimethyl-(3-phenylmethoxy-5-trimethylsilylphenyl)silane |
|---|---|
| PubChem CID | 158971127 |
| Molecular Formula | C32H38Br2O2Si2 |
| Molecular Weight | 670.63 g/mol |
| Exact Mass | 668.08 |
| IUPAC Name | 1,3-dibromo-5-phenylmethoxybenzene;trimethyl-(3-phenylmethoxy-5-trimethylsilylphenyl)silane |
| SMILES | Brc1cc(Br)cc(OCc2ccccc2)c1.C[Si](C)(C)c1cc(OCc2ccccc2)cc([Si](C)(C)C)c1 |
| InChI | InChI=1S/C19H28OSi2.C13H10Br2O/c1-21(2,3)18-12-17(13-19(14-18)22(4,5)6)20-15-16-10-8-7-9-11-16;14-11-6-12(15)8-13(7-11)16-9-10-4-2-1-3-5-10/h7-14H,15H2,1-6H3;1-8H,9H2 |
| InChIKey | JNVHUKFHGHYJMQ-UHFFFAOYSA-N |
| XLogP | 9.15 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.63 |
| LogP ≤ 5 | 9.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|