C40H41ClN2O3 — CID 158974285
3-(4-tert-butylphenyl)-1-chloro-6-methoxyisoquinoline;3-(4-tert-butylphenyl)-6-methoxy-2H-isoquinolin-1-one (PubChem CID 158974285) has the molecular formula C40H41ClN2O3 and a molecular weight of 633.23 g/mol. Its IUPAC name is 3-(4-tert-butylphenyl)-1-chloro-6-methoxyisoquinoline;3-(4-tert-butylphenyl)-6-methoxy-2H-isoquinolin-1-one.
| Compound Name | 3-(4-tert-butylphenyl)-1-chloro-6-methoxyisoquinoline;3-(4-tert-butylphenyl)-6-methoxy-2H-isoquinolin-1-one |
|---|---|
| PubChem CID | 158974285 |
| Molecular Formula | C40H41ClN2O3 |
| Molecular Weight | 633.23 g/mol |
| Exact Mass | 632.28 |
| IUPAC Name | 3-(4-tert-butylphenyl)-1-chloro-6-methoxyisoquinoline;3-(4-tert-butylphenyl)-6-methoxy-2H-isoquinolin-1-one |
| SMILES | COc1ccc2c(=O)[nH]c(-c3ccc(C(C)(C)C)cc3)cc2c1.COc1ccc2c(Cl)nc(-c3ccc(C(C)(C)C)cc3)cc2c1 |
| InChI | InChI=1S/C20H20ClNO.C20H21NO2/c1-20(2,3)15-7-5-13(6-8-15)18-12-14-11-16(23-4)9-10-17(14)19(21)22-18;1-20(2,3)15-7-5-13(6-8-15)18-12-14-11-16(23-4)9-10-17(14)19(22)21-18/h5-12H,1-4H3;5-12H,1-4H3,(H,21,22) |
| InChIKey | JOEPEXUCCZTRFV-UHFFFAOYSA-N |
| XLogP | 10.36 |
| TPSA | 64.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.23 |
| LogP ≤ 5 | 10.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|