About 1,3-dihydroinden-2-one;1-(1H-inden-2-yl)pyrrolidine;pyrrolidine
1,3-dihydroinden-2-one;1-(1H-inden-2-yl)pyrrolidine;pyrrolidine (PubChem CID 158975642) has the molecular formula C26H32N2O
and a molecular weight of 388.56 g/mol. Its IUPAC name is 1,3-dihydroinden-2-one;1-(1H-inden-2-yl)pyrrolidine;pyrrolidine.
Molecular Properties
| Compound Name | 1,3-dihydroinden-2-one;1-(1H-inden-2-yl)pyrrolidine;pyrrolidine |
| PubChem CID | 158975642 |
| Molecular Formula | C26H32N2O |
| Molecular Weight | 388.56 g/mol |
| Exact Mass | 388.25 |
| IUPAC Name | 1,3-dihydroinden-2-one;1-(1H-inden-2-yl)pyrrolidine;pyrrolidine |
| SMILES | C1=C(N2CCCC2)Cc2ccccc21.C1CCNC1.O=C1Cc2ccccc2C1 |
| InChI | InChI=1S/C13H15N.C9H8O.C4H9N/c1-2-6-12-10-13(9-11(12)5-1)14-7-3-4-8-14;10-9-5-7-3-1-2-4-8(7)6-9;1-2-4-5-3-1/h1-2,5-6,9H,3-4,7-8,10H2;1-4H,5-6H2;5H,1-4H2 |
| InChIKey | JOIYXTSDRKEUSZ-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 388.56 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_ene_B(4)', 'substructure': 'N/A'} |
|---|
Analyze 1,3-dihydroinden-2-one;1-(1H-inden-2-yl)pyrrolidine;pyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dihydroinden-2-one;1-(1H-inden-2-yl)pyrrolidine;pyrrolidine?
The IUPAC name of 1,3-dihydroinden-2-one;1-(1H-inden-2-yl)pyrrolidine;pyrrolidine (CID 158975642) is 1,3-dihydroinden-2-one;1-(1H-inden-2-yl)pyrrolidine;pyrrolidine.
What is the SMILES notation for 1,3-dihydroinden-2-one;1-(1H-inden-2-yl)pyrrolidine;pyrrolidine?
The canonical SMILES for 1,3-dihydroinden-2-one;1-(1H-inden-2-yl)pyrrolidine;pyrrolidine is C1=C(N2CCCC2)Cc2ccccc21.C1CCNC1.O=C1Cc2ccccc2C1.
What is the InChIKey of 1,3-dihydroinden-2-one;1-(1H-inden-2-yl)pyrrolidine;pyrrolidine?
The InChIKey is JOIYXTSDRKEUSZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15N.C9H8O.C4H9N/c1-2-6-12-10-13(9-11(12)5-1)14-7-3-4-8-14;10-9-5-7-3-1-2-4-8(7)6-9;1-2-4-5-3-1/h1-2,5-6,9H,3-4,7-8,10H2;1-4H,5-6H2;5H,1-4H2.
What are the key properties of 1,3-dihydroinden-2-one;1-(1H-inden-2-yl)pyrrolidine;pyrrolidine?
1,3-dihydroinden-2-one;1-(1H-inden-2-yl)pyrrolidine;pyrrolidine has a molecular weight of 388.56 g/mol, XLogP of 4.40, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dihydroinden-2-one;1-(1H-inden-2-yl)pyrrolidine;pyrrolidine is sourced from PubChem (CID 158975642), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).