About 5-[3-[(1R)-1-aminopropyl]-6-chloro-2-fluorophenoxy]-N-methylpyridin-2-amine;molecular hydrogen
5-[3-[(1R)-1-aminopropyl]-6-chloro-2-fluorophenoxy]-N-methylpyridin-2-amine;molecular hydrogen (PubChem CID 158976164) has the molecular formula C15H25ClFN3O
and a molecular weight of 317.84 g/mol. Its IUPAC name is 5-[3-[(1R)-1-aminopropyl]-6-chloro-2-fluorophenoxy]-N-methylpyridin-2-amine;molecular hydrogen.
Molecular Properties
| Compound Name | 5-[3-[(1R)-1-aminopropyl]-6-chloro-2-fluorophenoxy]-N-methylpyridin-2-amine;molecular hydrogen |
| PubChem CID | 158976164 |
| Molecular Formula | C15H25ClFN3O |
| Molecular Weight | 317.84 g/mol |
| Exact Mass | 317.17 |
| IUPAC Name | 5-[3-[(1R)-1-aminopropyl]-6-chloro-2-fluorophenoxy]-N-methylpyridin-2-amine;molecular hydrogen |
| SMILES | CC[C@@H](N)c1ccc(Cl)c(Oc2ccc(NC)nc2)c1F.[H][H].[H][H].[H][H].[H][H] |
| InChI | InChI=1S/C15H17ClFN3O.4H2/c1-3-12(18)10-5-6-11(16)15(14(10)17)21-9-4-7-13(19-2)20-8-9;;;;/h4-8,12H,3,18H2,1-2H3,(H,19,20);4*1H/t12-;;;;/m1..../s1 |
| InChIKey | JOKOZLKSWLYOKN-HHUWXINPSA-N |
| XLogP | 5.10 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 317.84 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-[3-[(1R)-1-aminopropyl]-6-chloro-2-fluorophenoxy]-N-methylpyridin-2-amine;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[3-[(1R)-1-aminopropyl]-6-chloro-2-fluorophenoxy]-N-methylpyridin-2-amine;molecular hydrogen?
The IUPAC name of 5-[3-[(1R)-1-aminopropyl]-6-chloro-2-fluorophenoxy]-N-methylpyridin-2-amine;molecular hydrogen (CID 158976164) is 5-[3-[(1R)-1-aminopropyl]-6-chloro-2-fluorophenoxy]-N-methylpyridin-2-amine;molecular hydrogen.
What is the SMILES notation for 5-[3-[(1R)-1-aminopropyl]-6-chloro-2-fluorophenoxy]-N-methylpyridin-2-amine;molecular hydrogen?
The canonical SMILES for 5-[3-[(1R)-1-aminopropyl]-6-chloro-2-fluorophenoxy]-N-methylpyridin-2-amine;molecular hydrogen is CC[C@@H](N)c1ccc(Cl)c(Oc2ccc(NC)nc2)c1F.[H][H].[H][H].[H][H].[H][H].
What is the InChIKey of 5-[3-[(1R)-1-aminopropyl]-6-chloro-2-fluorophenoxy]-N-methylpyridin-2-amine;molecular hydrogen?
The InChIKey is JOKOZLKSWLYOKN-HHUWXINPSA-N. The full InChI is InChI=1S/C15H17ClFN3O.4H2/c1-3-12(18)10-5-6-11(16)15(14(10)17)21-9-4-7-13(19-2)20-8-9;;;;/h4-8,12H,3,18H2,1-2H3,(H,19,20);4*1H/t12-;;;;/m1..../s1.
What are the key properties of 5-[3-[(1R)-1-aminopropyl]-6-chloro-2-fluorophenoxy]-N-methylpyridin-2-amine;molecular hydrogen?
5-[3-[(1R)-1-aminopropyl]-6-chloro-2-fluorophenoxy]-N-methylpyridin-2-amine;molecular hydrogen has a molecular weight of 317.84 g/mol, XLogP of 5.10, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[3-[(1R)-1-aminopropyl]-6-chloro-2-fluorophenoxy]-N-methylpyridin-2-amine;molecular hydrogen is sourced from PubChem (CID 158976164), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).