About cyclopentene-1,2-dithiol
cyclopentene-1,2-dithiol (PubChem CID 15897860) has the molecular formula C5H8S2
and a molecular weight of 132.25 g/mol. Its IUPAC name is cyclopentene-1,2-dithiol.
Molecular Properties
| Compound Name | cyclopentene-1,2-dithiol |
| PubChem CID | 15897860 |
| Molecular Formula | C5H8S2 |
| Molecular Weight | 132.25 g/mol |
| Exact Mass | 132.01 |
| IUPAC Name | cyclopentene-1,2-dithiol |
| SMILES | SC1=C(S)CCC1 |
| InChI | InChI=1S/C5H8S2/c6-4-2-1-3-5(4)7/h6-7H,1-3H2 |
| InChIKey | ALVFCPMBEQMVID-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 132.25 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze cyclopentene-1,2-dithiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopentene-1,2-dithiol?
The IUPAC name of cyclopentene-1,2-dithiol (CID 15897860) is cyclopentene-1,2-dithiol.
What is the SMILES notation for cyclopentene-1,2-dithiol?
The canonical SMILES for cyclopentene-1,2-dithiol is SC1=C(S)CCC1.
What is the InChIKey of cyclopentene-1,2-dithiol?
The InChIKey is ALVFCPMBEQMVID-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8S2/c6-4-2-1-3-5(4)7/h6-7H,1-3H2.
What are the key properties of cyclopentene-1,2-dithiol?
cyclopentene-1,2-dithiol has a molecular weight of 132.25 g/mol, XLogP of 2.24, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopentene-1,2-dithiol is sourced from PubChem (CID 15897860), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).