C34H30N14O8 — CID 158978642
2-(5-nitrobenzimidazol-1-yl)-9-(oxan-4-yl)-7H-purin-8-one;2-(6-nitrobenzimidazol-1-yl)-9-(oxan-4-yl)-7H-purin-8-one (PubChem CID 158978642) has the molecular formula C34H30N14O8 and a molecular weight of 762.70 g/mol. Its IUPAC name is 2-(5-nitrobenzimidazol-1-yl)-9-(oxan-4-yl)-7H-purin-8-one;2-(6-nitrobenzimidazol-1-yl)-9-(oxan-4-yl)-7H-purin-8-one.
| Compound Name | 2-(5-nitrobenzimidazol-1-yl)-9-(oxan-4-yl)-7H-purin-8-one;2-(6-nitrobenzimidazol-1-yl)-9-(oxan-4-yl)-7H-purin-8-one |
|---|---|
| PubChem CID | 158978642 |
| Molecular Formula | C34H30N14O8 |
| Molecular Weight | 762.70 g/mol |
| Exact Mass | 762.24 |
| IUPAC Name | 2-(5-nitrobenzimidazol-1-yl)-9-(oxan-4-yl)-7H-purin-8-one;2-(6-nitrobenzimidazol-1-yl)-9-(oxan-4-yl)-7H-purin-8-one |
| SMILES | O=c1[nH]c2cnc(-n3cnc4cc([N+](=O)[O-])ccc43)nc2n1C1CCOCC1.O=c1[nH]c2cnc(-n3cnc4ccc([N+](=O)[O-])cc43)nc2n1C1CCOCC1 |
| InChI | InChI=1S/2C17H15N7O4/c25-17-20-13-8-18-16(21-15(13)23(17)10-3-5-28-6-4-10)22-9-19-12-7-11(24(26)27)1-2-14(12)22;25-17-20-13-8-18-16(21-15(13)23(17)10-3-5-28-6-4-10)22-9-19-12-2-1-11(24(26)27)7-14(12)22/h2*1-2,7-10H,3-6H2,(H,20,25) |
| InChIKey | JOSBNSUSSPXTEM-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 267.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 762.70 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|