C33H29NO5 — CID 158980065
5-[4-[[2-[4-(1-benzofuran-2-yl)phenoxy]-1-phenylethyl]amino]phenyl]-5-oxopentanoic acid (PubChem CID 158980065) has the molecular formula C33H29NO5 and a molecular weight of 519.60 g/mol. Its IUPAC name is 5-[4-[[2-[4-(1-benzofuran-2-yl)phenoxy]-1-phenylethyl]amino]phenyl]-5-oxopentanoic acid.
| Compound Name | 5-[4-[[2-[4-(1-benzofuran-2-yl)phenoxy]-1-phenylethyl]amino]phenyl]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 158980065 |
| Molecular Formula | C33H29NO5 |
| Molecular Weight | 519.60 g/mol |
| Exact Mass | 519.20 |
| IUPAC Name | 5-[4-[[2-[4-(1-benzofuran-2-yl)phenoxy]-1-phenylethyl]amino]phenyl]-5-oxopentanoic acid |
| SMILES | O=C(O)CCCC(=O)c1ccc(NC(COc2ccc(-c3cc4ccccc4o3)cc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C33H29NO5/c35-30(10-6-12-33(36)37)24-13-17-27(18-14-24)34-29(23-7-2-1-3-8-23)22-38-28-19-15-25(16-20-28)32-21-26-9-4-5-11-31(26)39-32/h1-5,7-9,11,13-21,29,34H,6,10,12,22H2,(H,36,37) |
| InChIKey | JOWOWNJJXUGYFZ-UHFFFAOYSA-N |
| XLogP | 7.77 |
| TPSA | 88.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.60 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |