About N-[3-(1,3-dioxolan-2-yl)phenyl]pyridin-2-amine;3-(pyridin-2-ylamino)benzaldehyde
N-[3-(1,3-dioxolan-2-yl)phenyl]pyridin-2-amine;3-(pyridin-2-ylamino)benzaldehyde (PubChem CID 158981449) has the molecular formula C26H24N4O3
and a molecular weight of 440.50 g/mol. Its IUPAC name is N-[3-(1,3-dioxolan-2-yl)phenyl]pyridin-2-amine;3-(pyridin-2-ylamino)benzaldehyde.
Molecular Properties
| Compound Name | N-[3-(1,3-dioxolan-2-yl)phenyl]pyridin-2-amine;3-(pyridin-2-ylamino)benzaldehyde |
| PubChem CID | 158981449 |
| Molecular Formula | C26H24N4O3 |
| Molecular Weight | 440.50 g/mol |
| Exact Mass | 440.18 |
| IUPAC Name | N-[3-(1,3-dioxolan-2-yl)phenyl]pyridin-2-amine;3-(pyridin-2-ylamino)benzaldehyde |
| SMILES | O=Cc1cccc(Nc2ccccn2)c1.c1ccc(Nc2cccc(C3OCCO3)c2)nc1 |
| InChI | InChI=1S/C14H14N2O2.C12H10N2O/c1-2-7-15-13(6-1)16-12-5-3-4-11(10-12)14-17-8-9-18-14;15-9-10-4-3-5-11(8-10)14-12-6-1-2-7-13-12/h1-7,10,14H,8-9H2,(H,15,16);1-9H,(H,13,14) |
| InChIKey | JPBBANUBIRKNJL-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 85.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 440.50 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze N-[3-(1,3-dioxolan-2-yl)phenyl]pyridin-2-amine;3-(pyridin-2-ylamino)benzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-(1,3-dioxolan-2-yl)phenyl]pyridin-2-amine;3-(pyridin-2-ylamino)benzaldehyde?
The IUPAC name of N-[3-(1,3-dioxolan-2-yl)phenyl]pyridin-2-amine;3-(pyridin-2-ylamino)benzaldehyde (CID 158981449) is N-[3-(1,3-dioxolan-2-yl)phenyl]pyridin-2-amine;3-(pyridin-2-ylamino)benzaldehyde.
What is the SMILES notation for N-[3-(1,3-dioxolan-2-yl)phenyl]pyridin-2-amine;3-(pyridin-2-ylamino)benzaldehyde?
The canonical SMILES for N-[3-(1,3-dioxolan-2-yl)phenyl]pyridin-2-amine;3-(pyridin-2-ylamino)benzaldehyde is O=Cc1cccc(Nc2ccccn2)c1.c1ccc(Nc2cccc(C3OCCO3)c2)nc1.
What is the InChIKey of N-[3-(1,3-dioxolan-2-yl)phenyl]pyridin-2-amine;3-(pyridin-2-ylamino)benzaldehyde?
The InChIKey is JPBBANUBIRKNJL-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14N2O2.C12H10N2O/c1-2-7-15-13(6-1)16-12-5-3-4-11(10-12)14-17-8-9-18-14;15-9-10-4-3-5-11(8-10)14-12-6-1-2-7-13-12/h1-7,10,14H,8-9H2,(H,15,16);1-9H,(H,13,14).
What are the key properties of N-[3-(1,3-dioxolan-2-yl)phenyl]pyridin-2-amine;3-(pyridin-2-ylamino)benzaldehyde?
N-[3-(1,3-dioxolan-2-yl)phenyl]pyridin-2-amine;3-(pyridin-2-ylamino)benzaldehyde has a molecular weight of 440.50 g/mol, XLogP of 5.51, 6 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-(1,3-dioxolan-2-yl)phenyl]pyridin-2-amine;3-(pyridin-2-ylamino)benzaldehyde is sourced from PubChem (CID 158981449), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).