About [(2R)-butan-2-yl] 2-[1-(3,4-difluorobenzoyl)-4,6-difluoro-5-hydroxy-2-methylindol-3-yl]acetate
[(2R)-butan-2-yl] 2-[1-(3,4-difluorobenzoyl)-4,6-difluoro-5-hydroxy-2-methylindol-3-yl]acetate (PubChem CID 158982314) has the molecular formula C22H19F4NO4
and a molecular weight of 437.39 g/mol. Its IUPAC name is [(2R)-butan-2-yl] 2-[1-(3,4-difluorobenzoyl)-4,6-difluoro-5-hydroxy-2-methylindol-3-yl]acetate.
Molecular Properties
| Compound Name | [(2R)-butan-2-yl] 2-[1-(3,4-difluorobenzoyl)-4,6-difluoro-5-hydroxy-2-methylindol-3-yl]acetate |
| PubChem CID | 158982314 |
| Molecular Formula | C22H19F4NO4 |
| Molecular Weight | 437.39 g/mol |
| Exact Mass | 437.13 |
| IUPAC Name | [(2R)-butan-2-yl] 2-[1-(3,4-difluorobenzoyl)-4,6-difluoro-5-hydroxy-2-methylindol-3-yl]acetate |
| SMILES | CC[C@@H](C)OC(=O)Cc1c(C)n(C(=O)c2ccc(F)c(F)c2)c2cc(F)c(O)c(F)c12 |
| InChI | InChI=1S/C22H19F4NO4/c1-4-10(2)31-18(28)8-13-11(3)27(17-9-16(25)21(29)20(26)19(13)17)22(30)12-5-6-14(23)15(24)7-12/h5-7,9-10,29H,4,8H2,1-3H3/t10-/m1/s1 |
| InChIKey | JPDQUVRAGQKTGC-SNVBAGLBSA-N |
| XLogP | 4.78 |
| TPSA | 68.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 437.39 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [(2R)-butan-2-yl] 2-[1-(3,4-difluorobenzoyl)-4,6-difluoro-5-hydroxy-2-methylindol-3-yl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2R)-butan-2-yl] 2-[1-(3,4-difluorobenzoyl)-4,6-difluoro-5-hydroxy-2-methylindol-3-yl]acetate?
The IUPAC name of [(2R)-butan-2-yl] 2-[1-(3,4-difluorobenzoyl)-4,6-difluoro-5-hydroxy-2-methylindol-3-yl]acetate (CID 158982314) is [(2R)-butan-2-yl] 2-[1-(3,4-difluorobenzoyl)-4,6-difluoro-5-hydroxy-2-methylindol-3-yl]acetate.
What is the SMILES notation for [(2R)-butan-2-yl] 2-[1-(3,4-difluorobenzoyl)-4,6-difluoro-5-hydroxy-2-methylindol-3-yl]acetate?
The canonical SMILES for [(2R)-butan-2-yl] 2-[1-(3,4-difluorobenzoyl)-4,6-difluoro-5-hydroxy-2-methylindol-3-yl]acetate is CC[C@@H](C)OC(=O)Cc1c(C)n(C(=O)c2ccc(F)c(F)c2)c2cc(F)c(O)c(F)c12.
What is the InChIKey of [(2R)-butan-2-yl] 2-[1-(3,4-difluorobenzoyl)-4,6-difluoro-5-hydroxy-2-methylindol-3-yl]acetate?
The InChIKey is JPDQUVRAGQKTGC-SNVBAGLBSA-N. The full InChI is InChI=1S/C22H19F4NO4/c1-4-10(2)31-18(28)8-13-11(3)27(17-9-16(25)21(29)20(26)19(13)17)22(30)12-5-6-14(23)15(24)7-12/h5-7,9-10,29H,4,8H2,1-3H3/t10-/m1/s1.
What are the key properties of [(2R)-butan-2-yl] 2-[1-(3,4-difluorobenzoyl)-4,6-difluoro-5-hydroxy-2-methylindol-3-yl]acetate?
[(2R)-butan-2-yl] 2-[1-(3,4-difluorobenzoyl)-4,6-difluoro-5-hydroxy-2-methylindol-3-yl]acetate has a molecular weight of 437.39 g/mol, XLogP of 4.78, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(2R)-butan-2-yl] 2-[1-(3,4-difluorobenzoyl)-4,6-difluoro-5-hydroxy-2-methylindol-3-yl]acetate is sourced from PubChem (CID 158982314), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).