C18H15N3OS2 — CID 158982318
1-[4-(2,4-dimethyl-1,3-thiazol-5-yl)-1,3-thiazol-2-yl]-3-(2-isocyanophenyl)propan-2-one (PubChem CID 158982318) has the molecular formula C18H15N3OS2 and a molecular weight of 353.47 g/mol. Its IUPAC name is 1-[4-(2,4-dimethyl-1,3-thiazol-5-yl)-1,3-thiazol-2-yl]-3-(2-isocyanophenyl)propan-2-one.
| Compound Name | 1-[4-(2,4-dimethyl-1,3-thiazol-5-yl)-1,3-thiazol-2-yl]-3-(2-isocyanophenyl)propan-2-one |
|---|---|
| PubChem CID | 158982318 |
| Molecular Formula | C18H15N3OS2 |
| Molecular Weight | 353.47 g/mol |
| Exact Mass | 353.07 |
| IUPAC Name | 1-[4-(2,4-dimethyl-1,3-thiazol-5-yl)-1,3-thiazol-2-yl]-3-(2-isocyanophenyl)propan-2-one |
| SMILES | [C-]#[N+]c1ccccc1CC(=O)Cc1nc(-c2sc(C)nc2C)cs1 |
| InChI | InChI=1S/C18H15N3OS2/c1-11-18(24-12(2)20-11)16-10-23-17(21-16)9-14(22)8-13-6-4-5-7-15(13)19-3/h4-7,10H,8-9H2,1-2H3 |
| InChIKey | JPDRFJFETDZDOI-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 47.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.47 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|