About benzaldehyde;bicyclo[2.2.1]hept-2-ene;4-methylaniline
benzaldehyde;bicyclo[2.2.1]hept-2-ene;4-methylaniline (PubChem CID 158983686) has the molecular formula C21H25NO
and a molecular weight of 307.44 g/mol. Its IUPAC name is benzaldehyde;bicyclo[2.2.1]hept-2-ene;4-methylaniline.
Molecular Properties
| Compound Name | benzaldehyde;bicyclo[2.2.1]hept-2-ene;4-methylaniline |
| PubChem CID | 158983686 |
| Molecular Formula | C21H25NO |
| Molecular Weight | 307.44 g/mol |
| Exact Mass | 307.19 |
| IUPAC Name | benzaldehyde;bicyclo[2.2.1]hept-2-ene;4-methylaniline |
| SMILES | C1=CC2CCC1C2.Cc1ccc(N)cc1.O=Cc1ccccc1 |
| InChI | InChI=1S/C7H9N.C7H6O.C7H10/c1-6-2-4-7(8)5-3-6;8-6-7-4-2-1-3-5-7;1-2-7-4-3-6(1)5-7/h2-5H,8H2,1H3;1-6H;1-2,6-7H,3-5H2 |
| InChIKey | JPHPSMLWZCGXKN-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 307.44 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze benzaldehyde;bicyclo[2.2.1]hept-2-ene;4-methylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzaldehyde;bicyclo[2.2.1]hept-2-ene;4-methylaniline?
The IUPAC name of benzaldehyde;bicyclo[2.2.1]hept-2-ene;4-methylaniline (CID 158983686) is benzaldehyde;bicyclo[2.2.1]hept-2-ene;4-methylaniline.
What is the SMILES notation for benzaldehyde;bicyclo[2.2.1]hept-2-ene;4-methylaniline?
The canonical SMILES for benzaldehyde;bicyclo[2.2.1]hept-2-ene;4-methylaniline is C1=CC2CCC1C2.Cc1ccc(N)cc1.O=Cc1ccccc1.
What is the InChIKey of benzaldehyde;bicyclo[2.2.1]hept-2-ene;4-methylaniline?
The InChIKey is JPHPSMLWZCGXKN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9N.C7H6O.C7H10/c1-6-2-4-7(8)5-3-6;8-6-7-4-2-1-3-5-7;1-2-7-4-3-6(1)5-7/h2-5H,8H2,1H3;1-6H;1-2,6-7H,3-5H2.
What are the key properties of benzaldehyde;bicyclo[2.2.1]hept-2-ene;4-methylaniline?
benzaldehyde;bicyclo[2.2.1]hept-2-ene;4-methylaniline has a molecular weight of 307.44 g/mol, XLogP of 5.05, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for benzaldehyde;bicyclo[2.2.1]hept-2-ene;4-methylaniline is sourced from PubChem (CID 158983686), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).