About (1-ethenylcyclohexa-2,4-dien-1-yl)methyl-trimethylazanium
(1-ethenylcyclohexa-2,4-dien-1-yl)methyl-trimethylazanium (PubChem CID 158984229) has the molecular formula C12H20N+
and a molecular weight of 178.30 g/mol. Its IUPAC name is (1-ethenylcyclohexa-2,4-dien-1-yl)methyl-trimethylazanium.
Molecular Properties
| Compound Name | (1-ethenylcyclohexa-2,4-dien-1-yl)methyl-trimethylazanium |
| PubChem CID | 158984229 |
| Molecular Formula | C12H20N+ |
| Molecular Weight | 178.30 g/mol |
| Exact Mass | 178.16 |
| IUPAC Name | (1-ethenylcyclohexa-2,4-dien-1-yl)methyl-trimethylazanium |
| SMILES | C=CC1(C[N+](C)(C)C)C=CC=CC1 |
| InChI | InChI=1S/C12H20N/c1-5-12(11-13(2,3)4)9-7-6-8-10-12/h5-9H,1,10-11H2,2-4H3/q+1 |
| InChIKey | FLXZDZSDKGOMSB-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.30 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze (1-ethenylcyclohexa-2,4-dien-1-yl)methyl-trimethylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-ethenylcyclohexa-2,4-dien-1-yl)methyl-trimethylazanium?
The IUPAC name of (1-ethenylcyclohexa-2,4-dien-1-yl)methyl-trimethylazanium (CID 158984229) is (1-ethenylcyclohexa-2,4-dien-1-yl)methyl-trimethylazanium.
What is the SMILES notation for (1-ethenylcyclohexa-2,4-dien-1-yl)methyl-trimethylazanium?
The canonical SMILES for (1-ethenylcyclohexa-2,4-dien-1-yl)methyl-trimethylazanium is C=CC1(C[N+](C)(C)C)C=CC=CC1.
What is the InChIKey of (1-ethenylcyclohexa-2,4-dien-1-yl)methyl-trimethylazanium?
The InChIKey is FLXZDZSDKGOMSB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20N/c1-5-12(11-13(2,3)4)9-7-6-8-10-12/h5-9H,1,10-11H2,2-4H3/q+1.
What are the key properties of (1-ethenylcyclohexa-2,4-dien-1-yl)methyl-trimethylazanium?
(1-ethenylcyclohexa-2,4-dien-1-yl)methyl-trimethylazanium has a molecular weight of 178.30 g/mol, XLogP of 2.38, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (1-ethenylcyclohexa-2,4-dien-1-yl)methyl-trimethylazanium is sourced from PubChem (CID 158984229), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).